The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(2-(4-2-(5-chloro-2,4-dimethoxyphenyl)imidazo[1,2-a]pyridine-7-yl)piperazin-1-yl)pyrimidin-4-yl)morpholine ID: ALA4513600
PubChem CID: 135335530
Max Phase: Preclinical
Molecular Formula: C27H30ClN7O3
Molecular Weight: 536.04
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(OC)c(-c2cn3ccc(N4CCN(c5nccc(N6CCOCC6)n5)CC4)cc3n2)cc1Cl
Standard InChI: InChI=1S/C27H30ClN7O3/c1-36-23-17-24(37-2)21(28)16-20(23)22-18-35-6-4-19(15-26(35)30-22)32-7-9-34(10-8-32)27-29-5-3-25(31-27)33-11-13-38-14-12-33/h3-6,15-18H,7-14H2,1-2H3
Standard InChI Key: DAYAQFNKPUXICV-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 43 0 0 0 0 0 0 0 0999 V2000
7.9350 -3.8100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9338 -4.6367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6482 -5.0494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6464 -3.3974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1520 -3.5479 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.3613 -3.8063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3638 -4.6389 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.1572 -4.8924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6421 -4.2156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4654 -4.2102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8811 -4.9235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7047 -4.9191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1137 -4.2022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6930 -3.4882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8708 -3.4961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9366 -4.2014 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.5195 -4.7843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0997 -2.7690 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
11.4633 -5.6337 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.6388 -5.6337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2216 -3.3935 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.2234 -2.5680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5134 -2.1561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7971 -2.5650 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.7953 -3.3904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5098 -3.8069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0864 -2.1519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0906 -1.3264 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.3790 -0.9116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6626 -1.3214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6623 -2.1501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3745 -2.5611 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.9483 -2.5624 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.2360 -2.1486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5241 -2.5573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5199 -3.3821 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2337 -3.7965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9518 -3.3861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 7 1 0
6 4 1 0
4 1 2 0
6 7 1 0
5 6 2 0
7 8 1 0
8 9 2 0
9 5 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
9 10 1 0
13 16 1 0
16 17 1 0
14 18 1 0
11 19 1 0
19 20 1 0
21 22 1 0
21 26 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
1 21 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
24 27 1 0
31 33 1 0
33 34 1 0
33 38 1 0
34 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 536.04Molecular Weight (Monoisotopic): 535.2099AlogP: 3.63#Rotatable Bonds: 6Polar Surface Area: 80.49Molecular Species: NEUTRALHBA: 10HBD: ┄#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 6.87CX LogP: 4.17CX LogD: 4.05Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.37Np Likeness Score: -1.68
References 1. (2018) Bicyclic compound and use thereof for inhibiting suv39h2,