The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
19-O-Acetylclinopodiolide A ID: ALA4513604
PubChem CID: 155538845
Max Phase: Preclinical
Molecular Formula: C23H30O6
Molecular Weight: 402.49
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1c(C(C)C)cc2c(c1O)[C@]13CCC[C@](C)([C@H](OC(C)=O)OC1=O)[C@@H]3CC2
Standard InChI: InChI=1S/C23H30O6/c1-12(2)15-11-14-7-8-16-22(4)9-6-10-23(16,17(14)18(25)19(15)27-5)20(26)29-21(22)28-13(3)24/h11-12,16,21,25H,6-10H2,1-5H3/t16-,21+,22-,23+/m0/s1
Standard InChI Key: UNQVCHJFBNMSGB-AZIXLERZSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
12.6208 -4.9591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3342 -4.5399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6162 -4.1296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6252 -5.7841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0522 -4.9457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3342 -3.7149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7613 -3.7149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7524 -4.5443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0522 -3.2956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4746 -5.3069 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.9116 -6.1900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3387 -6.1944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4969 -6.9034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0522 -5.7841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4837 -3.2956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9161 -4.5310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0522 -2.4795 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.1892 -5.7841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1892 -4.9591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4883 -2.4795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1973 -3.7149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6787 -6.6047 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
12.3219 -6.8990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3455 -2.0715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8491 -3.6881 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7298 -7.3405 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.9676 -6.8947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2004 -7.3318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9727 -6.0117 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.6187 -3.3041 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
1 3 1 1
4 1 1 0
5 2 2 0
6 2 1 0
7 9 1 0
8 5 1 0
9 6 2 0
10 3 1 0
11 4 1 0
12 4 1 0
13 11 1 0
14 12 1 0
15 7 1 0
16 1 1 0
17 9 1 0
18 19 1 0
19 16 1 0
20 15 1 0
21 15 1 0
4 22 1 6
11 18 1 0
5 14 1 0
10 13 1 0
8 7 2 0
11 23 1 6
17 24 1 0
3 25 2 0
13 26 1 6
26 27 1 0
27 28 1 0
27 29 2 0
6 30 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 402.49Molecular Weight (Monoisotopic): 402.2042AlogP: 3.96#Rotatable Bonds: 3Polar Surface Area: 82.06Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.86CX Basic pKa: ┄CX LogP: 4.75CX LogD: 4.75Aromatic Rings: 1Heavy Atoms: 29QED Weighted: 0.77Np Likeness Score: 2.36
References 1. Bustos-Brito C, Joseph-Nathan P, Burgueño-Tapia E, Martínez-Otero D, Nieto-Camacho A, Calzada F, Yépez-Mulia L, Esquivel B, Quijano L.. (2019) Structure and Absolute Configuration of Abietane Diterpenoids from Salvia clinopodioides: Antioxidant, Antiprotozoal, and Antipropulsive Activities., 82 (5): [PMID:31063376 ] [10.1021/acs.jnatprod.8b00952 ]