The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-N-hydroxy-3-(3-(((9-isopropyl-2-(piperidin-1-yl)-9H-purin-6-yl)amino)methyl)phenyl)acrylamide ID: ALA4513637
PubChem CID: 155538971
Max Phase: Preclinical
Molecular Formula: C23H29N7O2
Molecular Weight: 435.53
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)n1cnc2c(NCc3cccc(/C=C/C(=O)NO)c3)nc(N3CCCCC3)nc21
Standard InChI: InChI=1S/C23H29N7O2/c1-16(2)30-15-25-20-21(26-23(27-22(20)30)29-11-4-3-5-12-29)24-14-18-8-6-7-17(13-18)9-10-19(31)28-32/h6-10,13,15-16,32H,3-5,11-12,14H2,1-2H3,(H,28,31)(H,24,26,27)/b10-9+
Standard InChI Key: GYILFKJMMAACBR-MDZDMXLPSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
15.1827 -7.6684 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.1815 -8.4879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8896 -8.8969 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.8878 -7.2595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5964 -7.6648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6012 -8.4834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3812 -8.7318 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.8586 -8.0667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3735 -7.4073 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.4735 -8.8959 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.8853 -6.4423 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.1764 -6.0358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1740 -5.2186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8823 -4.8126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8802 -3.9962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1708 -3.5889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4620 -4.0040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4675 -4.8191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7516 -3.6000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7463 -2.7829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0359 -2.3789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0306 -1.5617 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.3309 -2.7921 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.7356 -1.1485 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.7698 -8.4823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0639 -8.8869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0590 -9.7044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7662 -10.1157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4783 -9.7095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6383 -9.5075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4386 -9.6728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0950 -10.1180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
2 10 1 0
4 11 1 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
17 19 1 0
19 20 2 0
20 21 1 0
21 22 1 0
21 23 2 0
22 24 1 0
10 25 1 0
10 29 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
7 30 1 0
30 31 1 0
30 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 435.53Molecular Weight (Monoisotopic): 435.2383AlogP: 3.53#Rotatable Bonds: 7Polar Surface Area: 108.20Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.56CX Basic pKa: 5.07CX LogP: 3.48CX LogD: 3.48Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.30Np Likeness Score: -0.84
References 1. Yu Y, Ran D, Jiang J, Pan T, Dan Y, Tang Q, Li W, Zhang L, Gan L, Gan Z.. (2019) Discovery of novel 9H-purin derivatives as dual inhibitors of HDAC1 and CDK2., 29 (16): [PMID:31272794 ] [10.1016/j.bmcl.2019.06.059 ]