The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-(2-(dimethylamino)ethoxy)-4-(pyridin-4-yl)phenyl)-6-methylchroman-3-carboxamide ID: ALA4513652
PubChem CID: 117078758
Max Phase: Preclinical
Molecular Formula: C26H29N3O3
Molecular Weight: 431.54
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc2c(c1)CC(C(=O)Nc1ccc(-c3ccncc3)cc1OCCN(C)C)CO2
Standard InChI: InChI=1S/C26H29N3O3/c1-18-4-7-24-21(14-18)15-22(17-32-24)26(30)28-23-6-5-20(19-8-10-27-11-9-19)16-25(23)31-13-12-29(2)3/h4-11,14,16,22H,12-13,15,17H2,1-3H3,(H,28,30)
Standard InChI Key: AGRVRDSFRWARJF-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
15.1083 -12.3317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6989 -13.0399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1118 -13.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9269 -13.7468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9247 -12.3320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3314 -13.0420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1452 -13.0448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5583 -12.3392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1516 -11.6292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3317 -11.6248 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.3755 -12.3431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7808 -13.0527 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.7875 -11.6373 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.6047 -11.6412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0066 -12.3512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8230 -12.3554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2358 -11.6491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8261 -10.9371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0111 -10.9364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5931 -13.0561 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.9969 -13.7666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5834 -14.4715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9872 -15.1820 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.5737 -15.8869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8043 -15.1876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0529 -11.6519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4559 -12.3632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2723 -12.3664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6841 -11.6595 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.2736 -10.9481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4585 -10.9484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7057 -14.4591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
8 11 1 0
11 12 2 0
11 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
15 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
23 25 1 0
17 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
3 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 431.54Molecular Weight (Monoisotopic): 431.2209AlogP: 4.19#Rotatable Bonds: 7Polar Surface Area: 63.69Molecular Species: BASEHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.27CX Basic pKa: 8.71CX LogP: 3.92CX LogD: 2.59Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.61Np Likeness Score: -1.18
References 1. Pan J, Yin Y, Zhao L, Feng Y.. (2019) Discovery of (S)-6-methoxy-chroman-3-carboxylic acid (4-pyridin-4-yl-phenyl)-amide as potent and isoform selective ROCK2 inhibitors., 27 (7): [PMID:30819619 ] [10.1016/j.bmc.2019.02.047 ]