N-(2-(2-(dimethylamino)ethoxy)-4-(pyridin-4-yl)phenyl)-6-methylchroman-3-carboxamide

ID: ALA4513652

PubChem CID: 117078758

Max Phase: Preclinical

Molecular Formula: C26H29N3O3

Molecular Weight: 431.54

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc2c(c1)CC(C(=O)Nc1ccc(-c3ccncc3)cc1OCCN(C)C)CO2

Standard InChI:  InChI=1S/C26H29N3O3/c1-18-4-7-24-21(14-18)15-22(17-32-24)26(30)28-23-6-5-20(19-8-10-27-11-9-19)16-25(23)31-13-12-29(2)3/h4-11,14,16,22H,12-13,15,17H2,1-3H3,(H,28,30)

Standard InChI Key:  AGRVRDSFRWARJF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   15.1083  -12.3317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6989  -13.0399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1118  -13.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9269  -13.7468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9247  -12.3320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3314  -13.0420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1452  -13.0448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5583  -12.3392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1516  -11.6292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3317  -11.6248    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.3755  -12.3431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7808  -13.0527    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.7875  -11.6373    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.6047  -11.6412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0066  -12.3512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8230  -12.3554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2358  -11.6491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8261  -10.9371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0111  -10.9364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5931  -13.0561    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.9969  -13.7666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5834  -14.4715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9872  -15.1820    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.5737  -15.8869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8043  -15.1876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0529  -11.6519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4559  -12.3632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2723  -12.3664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6841  -11.6595    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.2736  -10.9481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4585  -10.9484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7057  -14.4591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  5  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  6  2  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  8 11  1  0
 11 12  2  0
 11 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 15 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 23 25  1  0
 17 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
  3 32  1  0
M  END

Associated Targets(Human)

ROCK1 Tclin Rho-associated protein kinase 1 (4723 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ROCK2 Tclin Rho-associated protein kinase 2 (6206 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 431.54Molecular Weight (Monoisotopic): 431.2209AlogP: 4.19#Rotatable Bonds: 7
Polar Surface Area: 63.69Molecular Species: BASEHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 12.27CX Basic pKa: 8.71CX LogP: 3.92CX LogD: 2.59
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.61Np Likeness Score: -1.18

References

1. Pan J, Yin Y, Zhao L, Feng Y..  (2019)  Discovery of (S)-6-methoxy-chroman-3-carboxylic acid (4-pyridin-4-yl-phenyl)-amide as potent and isoform selective ROCK2 inhibitors.,  27  (7): [PMID:30819619] [10.1016/j.bmc.2019.02.047]

Source