The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-benzyl-1-ethyl-3-(2-fluorobenzyl)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine-2,4(1H,3H)-dione ID: ALA4513680
PubChem CID: 155539178
Max Phase: Preclinical
Molecular Formula: C23H24FN3O2
Molecular Weight: 393.46
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCn1c2c(c(=O)n(Cc3ccccc3F)c1=O)CN(Cc1ccccc1)CC2
Standard InChI: InChI=1S/C23H24FN3O2/c1-2-26-21-12-13-25(14-17-8-4-3-5-9-17)16-19(21)22(28)27(23(26)29)15-18-10-6-7-11-20(18)24/h3-11H,2,12-16H2,1H3
Standard InChI Key: ODCWITPOOPFHNN-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 32 0 0 0 0 0 0 0 0999 V2000
31.4041 -20.4587 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.4041 -21.2759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1094 -21.6803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1094 -20.0459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8146 -20.4587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8112 -21.2758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2267 -20.4647 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.5202 -20.0508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2233 -21.2818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5138 -21.6857 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.5225 -19.2336 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.9366 -20.0598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6952 -20.0522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9887 -20.4628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2803 -20.0532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5743 -20.4632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5763 -21.2812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2902 -21.6876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9933 -21.2753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9288 -21.6941 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.5094 -22.5029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7995 -22.9077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6421 -20.4721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6357 -21.2893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3404 -21.7015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0512 -21.2966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0529 -20.4752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3476 -20.0666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3490 -19.2495 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 1 0
2 3 1 0
3 6 1 0
5 4 1 0
5 6 2 0
5 8 1 0
6 10 1 0
9 7 1 0
7 8 1 0
9 10 1 0
8 11 2 0
7 12 1 0
1 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
9 20 2 0
10 21 1 0
21 22 1 0
12 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
28 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 393.46Molecular Weight (Monoisotopic): 393.1853AlogP: 2.78#Rotatable Bonds: 5Polar Surface Area: 47.24Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.02CX LogP: 3.10CX LogD: 2.39Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.67Np Likeness Score: -1.54
References 1. Ma Z, Gao G, Fang K, Sun H.. (2019) Development of Novel Anticancer Agents with a Scaffold of Tetrahydropyrido[4,3-d ]pyrimidine-2,4-dione., 10 (2): [PMID:30783502 ] [10.1021/acsmedchemlett.8b00531 ]