1-(4,5-Bis(4-(furan-3-yl)phenyl)thiophen-2-yl)-N-(piperidin-4-ylmethyl)methanamine

ID: ALA4513688

PubChem CID: 155539039

Max Phase: Preclinical

Molecular Formula: C31H30N2O2S

Molecular Weight: 494.66

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  c1cc(-c2ccc(-c3cc(CNCC4CCNCC4)sc3-c3ccc(-c4ccoc4)cc3)cc2)co1

Standard InChI:  InChI=1S/C31H30N2O2S/c1-5-25(6-2-23(1)27-11-15-34-20-27)30-17-29(19-33-18-22-9-13-32-14-10-22)36-31(30)26-7-3-24(4-8-26)28-12-16-35-21-28/h1-8,11-12,15-17,20-22,32-33H,9-10,13-14,18-19H2

Standard InChI Key:  HYFPEYVTCZZGEB-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 41  0  0  0  0  0  0  0  0999 V2000
   19.9383   -5.2663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1169   -5.2663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8603   -6.0476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5255   -6.5280    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   20.1907   -6.0476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9720   -6.3002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5835   -5.7492    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.3648   -6.0058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9721   -5.4549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7494   -5.7128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3594   -5.1698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1936   -4.3652    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.4119   -4.1064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7962   -4.6564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6344   -4.6056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9685   -3.8544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4889   -3.1896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6712   -3.2747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3353   -4.0302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8211   -4.6919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0825   -6.2992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4753   -5.7465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6946   -6.0026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5199   -6.8068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1362   -7.3545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9145   -7.0997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1885   -2.6110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4399   -1.8335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7782   -1.3498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1135   -1.8352    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.3672   -2.6120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7387   -7.0639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0770   -6.5803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4124   -7.0656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6659   -7.8467    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.4872   -7.8455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  5  1  2  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  9 14  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
  2 15  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
  3 21  1  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  1  0
 31 27  2  0
 18 27  1  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  1  0
 36 32  2  0
 24 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4513688

    ---

Associated Targets(Human)

EP300 Tchem Histone acetyltransferase p300 (1259 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 494.66Molecular Weight (Monoisotopic): 494.2028AlogP: 7.69#Rotatable Bonds: 8
Polar Surface Area: 50.34Molecular Species: BASEHBA: 5HBD: 2
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 10.52CX LogP: 6.41CX LogD: 1.11
Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.23Np Likeness Score: -0.13

References

1. Wu F, Hua Y, Kaochar S, Nie S, Lin YL, Yao Y, Wu J, Wu X, Fu X, Schiff R, Davis CM, Robertson M, Ehli EA, Coarfa C, Mitsiades N, Song Y..  (2020)  Discovery, Structure-Activity Relationship, and Biological Activity of Histone-Competitive Inhibitors of Histone Acetyltransferases P300/CBP.,  63  (9): [PMID:32314924] [10.1021/acs.jmedchem.9b02164]

Source