The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(4,5-Bis(4-(furan-3-yl)phenyl)thiophen-2-yl)-N-(piperidin-4-ylmethyl)methanamine ID: ALA4513688
PubChem CID: 155539039
Max Phase: Preclinical
Molecular Formula: C31H30N2O2S
Molecular Weight: 494.66
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: c1cc(-c2ccc(-c3cc(CNCC4CCNCC4)sc3-c3ccc(-c4ccoc4)cc3)cc2)co1
Standard InChI: InChI=1S/C31H30N2O2S/c1-5-25(6-2-23(1)27-11-15-34-20-27)30-17-29(19-33-18-22-9-13-32-14-10-22)36-31(30)26-7-3-24(4-8-26)28-12-16-35-21-28/h1-8,11-12,15-17,20-22,32-33H,9-10,13-14,18-19H2
Standard InChI Key: HYFPEYVTCZZGEB-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 41 0 0 0 0 0 0 0 0999 V2000
19.9383 -5.2663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1169 -5.2663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8603 -6.0476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5255 -6.5280 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
20.1907 -6.0476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9720 -6.3002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5835 -5.7492 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.3648 -6.0058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9721 -5.4549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7494 -5.7128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3594 -5.1698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1936 -4.3652 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.4119 -4.1064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7962 -4.6564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6344 -4.6056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9685 -3.8544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4889 -3.1896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6712 -3.2747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3353 -4.0302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8211 -4.6919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0825 -6.2992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4753 -5.7465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6946 -6.0026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5199 -6.8068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1362 -7.3545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9145 -7.0997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1885 -2.6110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4399 -1.8335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7782 -1.3498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1135 -1.8352 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.3672 -2.6120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7387 -7.0639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0770 -6.5803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4124 -7.0656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6659 -7.8467 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.4872 -7.8455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
5 1 2 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
9 14 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
2 15 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
3 21 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 1 0
31 27 2 0
18 27 1 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 1 0
36 32 2 0
24 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 494.66Molecular Weight (Monoisotopic): 494.2028AlogP: 7.69#Rotatable Bonds: 8Polar Surface Area: 50.34Molecular Species: BASEHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 10.52CX LogP: 6.41CX LogD: 1.11Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.23Np Likeness Score: -0.13
References 1. Wu F, Hua Y, Kaochar S, Nie S, Lin YL, Yao Y, Wu J, Wu X, Fu X, Schiff R, Davis CM, Robertson M, Ehli EA, Coarfa C, Mitsiades N, Song Y.. (2020) Discovery, Structure-Activity Relationship, and Biological Activity of Histone-Competitive Inhibitors of Histone Acetyltransferases P300/CBP., 63 (9): [PMID:32314924 ] [10.1021/acs.jmedchem.9b02164 ]