The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-cyclopentyl-1-methyl-7-(4-(pyrrolidin-1-yl)phenylamino)-[1,2,4]triazolo[4,3-f]pteridin-4(5H)-one ID: ALA4513712
PubChem CID: 153534157
Max Phase: Preclinical
Molecular Formula: C23H26N8O
Molecular Weight: 430.52
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1nnc2c(=O)n(C3CCCC3)c3nc(Nc4ccc(N5CCCC5)cc4)ncc3n12
Standard InChI: InChI=1S/C23H26N8O/c1-15-27-28-21-22(32)31(18-6-2-3-7-18)20-19(30(15)21)14-24-23(26-20)25-16-8-10-17(11-9-16)29-12-4-5-13-29/h8-11,14,18H,2-7,12-13H2,1H3,(H,24,25,26)
Standard InChI Key: QAAAQBYCFRXOHR-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 37 0 0 0 0 0 0 0 0999 V2000
34.1143 -4.7339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1131 -5.5534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8212 -5.9624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5308 -5.5530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5280 -4.7303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8194 -4.3250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8169 -3.5078 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.5234 -3.0971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2302 -3.5060 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.2203 -1.8716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5172 -2.2840 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.9342 -2.2779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9344 -3.0999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6424 -3.5085 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.3548 -3.0996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6421 -1.8645 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.3540 -2.2780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9673 -1.7288 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.6344 -0.9757 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.8155 -1.0597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0622 -3.5087 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.6415 -4.3257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9811 -4.8048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2327 -5.5823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0499 -5.5832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3032 -4.8063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8210 -6.7796 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.1611 -7.2624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4134 -8.0397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2306 -8.0399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4832 -7.2627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2703 -0.4509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 13 1 0
12 10 1 0
10 11 2 0
11 8 1 0
12 13 2 0
12 16 1 0
13 14 1 0
14 15 1 0
15 17 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 16 1 0
15 21 2 0
14 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 22 1 0
3 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 27 1 0
20 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 430.52Molecular Weight (Monoisotopic): 430.2230AlogP: 3.60#Rotatable Bonds: 4Polar Surface Area: 93.24Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 5.99CX LogP: 2.92CX LogD: 2.90Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.53Np Likeness Score: -1.52
References 1. Hou Y, Zhu L, Li Z, Shen Q, Xu Q, Li W, Liu Y, Gong P.. (2019) Design, synthesis and biological evaluation of novel 7-amino-[1,2,4]triazolo[4,3-f]pteridinone, and 7-aminotetrazolo[1,5-f]pteridinone derivative as potent antitumor agents., 163 [PMID:30572179 ] [10.1016/j.ejmech.2018.12.009 ]