The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Eucalypglobulusal F ID: ALA4513750
PubChem CID: 155539091
Max Phase: Preclinical
Molecular Formula: C28H38O6
Molecular Weight: 470.61
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C=C1/C=C/[C@H](C(C)(C)O)C[C@H]2[C@@H](CC(C)C)c3c(O)c(C=O)c(O)c(C=O)c3O[C@]2(C)CCC1
Standard InChI: InChI=1S/C28H38O6/c1-16(2)12-19-22-13-18(27(4,5)33)10-9-17(3)8-7-11-28(22,6)34-26-21(15-30)24(31)20(14-29)25(32)23(19)26/h9-10,14-16,18-19,22,31-33H,3,7-8,11-13H2,1-2,4-6H3/b10-9+/t18-,19+,22-,28+/m0/s1
Standard InChI Key: BFZHGJFXQVRHCT-PLCWZELZSA-N
Molfile:
RDKit 2D
35 37 0 0 0 0 0 0 0 0999 V2000
2.7610 -3.5290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7599 -4.3564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4746 -4.7692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4728 -3.1163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1883 -3.5254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1916 -4.3539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9068 -4.7629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9000 -3.1059 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6198 -3.5195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6205 -4.3455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3322 -4.7557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0478 -4.3444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3309 -3.1037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0446 -3.5187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7570 -3.1105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7618 -2.2854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0481 -1.8704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3295 -2.2803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4781 -1.8761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7626 -4.7562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7634 -5.5812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4766 -4.3430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4748 -5.1666 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6124 -5.1666 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
5.6124 -2.6916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4704 -2.2913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7547 -1.8810 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0464 -3.1167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0451 -4.7683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3310 -4.3552 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4752 -5.5942 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9108 -5.5879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6272 -5.9969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6313 -6.8218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3397 -5.5809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 8 1 0
6 7 1 0
7 10 1 0
9 8 1 0
9 10 1 0
9 13 1 0
10 11 1 0
11 12 1 0
12 14 1 0
13 18 1 0
14 15 2 0
15 16 1 0
16 17 1 0
17 18 1 0
16 19 2 0
12 20 1 6
20 21 1 0
20 22 1 0
20 23 1 0
10 24 1 6
9 25 1 1
4 26 1 0
26 27 2 0
1 28 1 0
2 29 1 0
29 30 2 0
3 31 1 0
7 32 1 1
32 33 1 0
33 34 1 0
33 35 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 470.61Molecular Weight (Monoisotopic): 470.2668AlogP: 5.69#Rotatable Bonds: 5Polar Surface Area: 104.06Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 6.88CX Basic pKa: ┄CX LogP: 7.08CX LogD: 6.42Aromatic Rings: 1Heavy Atoms: 34QED Weighted: 0.48Np Likeness Score: 2.33
References 1. Qin XJ, Jin LY, Yu Q, Liu H, Khan A, Yan H, Hao XJ, An LK, Liu HY.. (2018) Eucalypglobulusals A-J, Formyl-Phloroglucinol-Terpene Meroterpenoids from Eucalyptus globulus Fruits., 81 (12): [PMID:30543429 ] [10.1021/acs.jnatprod.8b00430 ]