1-(2-((6-(2-fluorophenyl)benzo[d][1,3]dioxol-5-yl)methyleneaminooxy)ethyl)piperidine-3-carboxylic acid

ID: ALA4513796

PubChem CID: 155539124

Max Phase: Preclinical

Molecular Formula: C22H23FN2O5

Molecular Weight: 414.43

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(O)C1CCCN(CCO/N=C/c2cc3c(cc2-c2ccccc2F)OCO3)C1

Standard InChI:  InChI=1S/C22H23FN2O5/c23-19-6-2-1-5-17(19)18-11-21-20(28-14-29-21)10-16(18)12-24-30-9-8-25-7-3-4-15(13-25)22(26)27/h1-2,5-6,10-12,15H,3-4,7-9,13-14H2,(H,26,27)/b24-12+

Standard InChI Key:  PMHIEFIFJKKUEO-WYMPLXKRSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   40.5604  -16.5715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.9769  -17.3906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.9741  -16.5679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.2655  -16.1627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.2673  -17.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.5592  -17.3911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1424  -16.5735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8520  -16.1641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8492  -15.3414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1406  -14.9361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.5554  -14.9301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.5523  -14.1130    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.4343  -16.1645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4310  -15.3480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6534  -15.0988    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.1761  -15.7614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6588  -16.4199    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.8512  -17.7991    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   41.2584  -13.7017    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   41.2554  -12.8845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.9615  -12.4733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.9584  -11.6561    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   42.6702  -11.2452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.6691  -10.4315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.9616  -10.0218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.2536  -10.4318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.2531  -11.2516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.3768  -10.0230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.0845  -10.4316    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.3768   -9.2058    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  6  2  0
  5  2  2  0
  2  3  1  0
  3  4  2  0
  4  1  1  0
  5  6  1  0
 13  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 14  1  0
  9 11  1  0
 11 12  2  0
  8  1  1  0
 13 14  2  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 13  1  0
  6 18  1  0
 12 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 22 27  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 24 28  1  0
 28 29  1  0
 28 30  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4513796

    ---

Associated Targets(non-human)

Slc6a1 GABA transporter 1 (1980 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 414.43Molecular Weight (Monoisotopic): 414.1591AlogP: 3.37#Rotatable Bonds: 7
Polar Surface Area: 80.59Molecular Species: ACIDHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 3.36CX Basic pKa: 8.24CX LogP: 1.01CX LogD: 0.97
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.43Np Likeness Score: -0.76

References

1. Kern F, Wanner KT..  (2019)  Screening oxime libraries by means of mass spectrometry (MS) binding assays: Identification of new highly potent inhibitors to optimized inhibitors γ-aminobutyric acid transporter 1.,  27  (7): [PMID:30777661] [10.1016/j.bmc.2019.02.015]

Source