The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(4-(Benzo[d]thiazol-2-ylmethoxy)-2-methylphenyl)-3-(4-chIorophenyl)urea ID: ALA4513805
PubChem CID: 155539161
Max Phase: Preclinical
Molecular Formula: C22H18ClN3O2S
Molecular Weight: 423.93
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(OCc2nc3ccccc3s2)ccc1NC(=O)Nc1ccc(Cl)cc1
Standard InChI: InChI=1S/C22H18ClN3O2S/c1-14-12-17(28-13-21-25-19-4-2-3-5-20(19)29-21)10-11-18(14)26-22(27)24-16-8-6-15(23)7-9-16/h2-12H,13H2,1H3,(H2,24,26,27)
Standard InChI Key: FUFQSQIDXQMXCV-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 32 0 0 0 0 0 0 0 0999 V2000
14.9845 -9.3481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9834 -10.1677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6914 -10.5766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6897 -8.9393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3983 -9.3445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4031 -10.1677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1875 -10.4175 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
17.6675 -9.7487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1797 -9.0856 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.4847 -9.7439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8891 -9.0338 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.7063 -9.0289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1169 -9.7336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9333 -9.7291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3386 -9.0185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9214 -8.3108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1063 -8.3188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1557 -9.0125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.5592 -8.3019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3764 -8.2960 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.1455 -7.5972 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.7901 -9.0007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3847 -9.7077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7977 -10.4119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6158 -10.4064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0190 -9.6908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6037 -8.9895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3458 -10.4346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0304 -11.1106 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
8 10 1 0
10 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
15 18 1 0
18 19 1 0
19 20 1 0
19 21 2 0
20 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
14 28 1 0
25 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 423.93Molecular Weight (Monoisotopic): 423.0808AlogP: 6.48#Rotatable Bonds: 5Polar Surface Area: 63.25Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.70CX Basic pKa: 1.32CX LogP: 6.02CX LogD: 6.02Aromatic Rings: 4Heavy Atoms: 29QED Weighted: 0.39Np Likeness Score: -2.34
References 1. Vieider L, Romp E, Temml V, Fischer J, Kretzer C, Schoenthaler M, Taha A, Hernández-Olmos V, Sturm S, Schuster D, Werz O, Garscha U, Matuszczak B.. (2019) Synthesis, Biological Evaluation and Structure-Activity Relationships of Diflapolin Analogues as Dual sEH/FLAP Inhibitors., 10 (1): [PMID:30655948 ] [10.1021/acsmedchemlett.8b00415 ]