The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(3,4,5-Trimethoxyphenyl)-5-((9-methyl-9H-carbazol-3-yl)methylene)-2-thioxothiazolidin-4-one ID: ALA4513832
PubChem CID: 155539048
Max Phase: Preclinical
Molecular Formula: C26H22N2O4S2
Molecular Weight: 490.61
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(N2C(=O)/C(=C/c3ccc4c(c3)c3ccccc3n4C)SC2=S)cc(OC)c1OC
Standard InChI: InChI=1S/C26H22N2O4S2/c1-27-19-8-6-5-7-17(19)18-11-15(9-10-20(18)27)12-23-25(29)28(26(33)34-23)16-13-21(30-2)24(32-4)22(14-16)31-3/h5-14H,1-4H3/b23-12-
Standard InChI Key: PXJZXSBMOOBVMA-FMCGGJTJSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
33.0701 -16.6616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0689 -17.4811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7770 -17.8901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7752 -16.2527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4838 -16.6580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4841 -17.4766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2627 -17.7294 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.2623 -16.4048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7419 -17.0650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5515 -16.9789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8825 -16.2333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3978 -15.5730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5900 -15.6624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7264 -14.8247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5167 -18.5061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5386 -14.7351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0882 -15.3377 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
38.8330 -15.0015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7434 -14.1891 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.9432 -14.0235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6064 -13.2789 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.5428 -15.4064 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
39.3478 -13.6392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.1242 -13.8886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.7283 -13.3394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.5545 -12.5400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7711 -12.2928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1704 -12.8437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5942 -11.4950 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.1967 -10.9429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1582 -11.9892 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.9370 -12.2367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.5067 -13.5882 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.6804 -14.3868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 9 1 0
8 5 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
12 14 1 0
7 15 1 0
14 16 2 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 16 1 0
20 21 2 0
18 22 2 0
19 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
27 29 1 0
29 30 1 0
26 31 1 0
31 32 1 0
25 33 1 0
33 34 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 490.61Molecular Weight (Monoisotopic): 490.1021AlogP: 5.76#Rotatable Bonds: 5Polar Surface Area: 52.93Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.49CX LogD: 5.49Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.26Np Likeness Score: -0.96
References 1. Shaikh MS, Kanhed AM, Chandrasekaran B, Palkar MB, Agrawal N, Lherbet C, Hampannavar GA, Karpoormath R.. (2019) Discovery of novel N-methyl carbazole tethered rhodanine derivatives as direct inhibitors of Mycobacterium tuberculosis InhA., 29 (16): [PMID:31227345 ] [10.1016/j.bmcl.2019.06.015 ]