The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(1-Hydroxynaphthalen-2-yl)-N,5-bis(3-methoxyphenyl)-pyrazoline-1-carbothioamide ID: ALA4513842
PubChem CID: 136706217
Max Phase: Preclinical
Molecular Formula: C28H25N3O3S
Molecular Weight: 483.59
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cccc(NC(=S)N2N=C(c3ccc4ccccc4c3O)CC2c2cccc(OC)c2)c1
Standard InChI: InChI=1S/C28H25N3O3S/c1-33-21-10-5-8-19(15-21)26-17-25(24-14-13-18-7-3-4-12-23(18)27(24)32)30-31(26)28(35)29-20-9-6-11-22(16-20)34-2/h3-16,26,32H,17H2,1-2H3,(H,29,35)
Standard InChI Key: KUPYEXLPZNOPGJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
24.4359 -19.8519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4348 -20.6715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1428 -21.0804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1410 -19.4431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8496 -19.8483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8504 -20.6673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5589 -21.0744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2672 -20.6636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2625 -19.8415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5533 -19.4381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9650 -19.4303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7135 -19.7581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2566 -19.1475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8437 -18.4423 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.0455 -18.6171 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.0682 -19.2250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4044 -19.9711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2168 -20.0518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6939 -19.3873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3529 -18.6401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5415 -18.5629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1715 -17.6937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9836 -17.6033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.6871 -17.0355 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
30.3114 -16.8547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1219 -16.7683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4497 -16.0205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9651 -15.3614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1490 -15.4549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8250 -16.2028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5533 -20.7965 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.0767 -21.4603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6623 -14.7985 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.9874 -14.0488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5490 -18.6209 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 6 1 0
5 4 1 0
4 1 2 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 11 2 0
9 11 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
13 16 1 0
14 22 1 0
22 23 1 0
22 24 2 0
23 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
18 31 1 0
31 32 1 0
29 33 1 0
33 34 1 0
10 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 483.59Molecular Weight (Monoisotopic): 483.1617AlogP: 6.11#Rotatable Bonds: 5Polar Surface Area: 66.32Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.29CX Basic pKa: 1.09CX LogP: 6.07CX LogD: 6.02Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.33Np Likeness Score: -0.88
References 1. Shin SY, Ahn S, Yoon H, Jung H, Jung Y, Koh D, Lee YH, Lim Y.. (2016) Colorectal anticancer activities of polymethoxylated 3-naphthyl-5-phenylpyrazoline-carbothioamides., 26 (17): [PMID:27476140 ] [10.1016/j.bmcl.2016.07.037 ]