3-(1-Hydroxynaphthalen-2-yl)-N,5-bis(3-methoxyphenyl)-pyrazoline-1-carbothioamide

ID: ALA4513842

PubChem CID: 136706217

Max Phase: Preclinical

Molecular Formula: C28H25N3O3S

Molecular Weight: 483.59

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cccc(NC(=S)N2N=C(c3ccc4ccccc4c3O)CC2c2cccc(OC)c2)c1

Standard InChI:  InChI=1S/C28H25N3O3S/c1-33-21-10-5-8-19(15-21)26-17-25(24-14-13-18-7-3-4-12-23(18)27(24)32)30-31(26)28(35)29-20-9-6-11-22(16-20)34-2/h3-16,26,32H,17H2,1-2H3,(H,29,35)

Standard InChI Key:  KUPYEXLPZNOPGJ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   24.4359  -19.8519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4348  -20.6715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1428  -21.0804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1410  -19.4431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8496  -19.8483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8504  -20.6673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5589  -21.0744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2672  -20.6636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2625  -19.8415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5533  -19.4381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9650  -19.4303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7135  -19.7581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2566  -19.1475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8437  -18.4423    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.0455  -18.6171    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.0682  -19.2250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4044  -19.9711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2168  -20.0518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6939  -19.3873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3529  -18.6401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5415  -18.5629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1715  -17.6937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9836  -17.6033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.6871  -17.0355    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   30.3114  -16.8547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1219  -16.7683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4497  -16.0205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9651  -15.3614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1490  -15.4549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8250  -16.2028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5533  -20.7965    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.0767  -21.4603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6623  -14.7985    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.9874  -14.0488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5490  -18.6209    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  6  1  0
  5  4  1  0
  4  1  2  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 11  2  0
  9 11  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 13 16  1  0
 14 22  1  0
 22 23  1  0
 22 24  2  0
 23 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 18 31  1  0
 31 32  1  0
 29 33  1  0
 33 34  1  0
 10 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4513842

    ---

Associated Targets(Human)

HCT-116 (91556 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 483.59Molecular Weight (Monoisotopic): 483.1617AlogP: 6.11#Rotatable Bonds: 5
Polar Surface Area: 66.32Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.29CX Basic pKa: 1.09CX LogP: 6.07CX LogD: 6.02
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.33Np Likeness Score: -0.88

References

1. Shin SY, Ahn S, Yoon H, Jung H, Jung Y, Koh D, Lee YH, Lim Y..  (2016)  Colorectal anticancer activities of polymethoxylated 3-naphthyl-5-phenylpyrazoline-carbothioamides.,  26  (17): [PMID:27476140] [10.1016/j.bmcl.2016.07.037]

Source