4-[[4-(4-Fluorophenyl)-4-methyl-5-oxazol-2-yl-2-thiazol-2-yl-1H-pyrimidin-6-yl]methyl]morpholine

ID: ALA4513853

PubChem CID: 155539168

Max Phase: Preclinical

Molecular Formula: C22H22FN5O2S

Molecular Weight: 439.52

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC1(c2ccc(F)cc2)N=C(c2nccs2)NC(CN2CCOCC2)=C1c1ncco1

Standard InChI:  InChI=1S/C22H22FN5O2S/c1-22(15-2-4-16(23)5-3-15)18(20-24-6-10-30-20)17(14-28-8-11-29-12-9-28)26-19(27-22)21-25-7-13-31-21/h2-7,10,13H,8-9,11-12,14H2,1H3,(H,26,27)

Standard InChI Key:  GSQXSKADQPDDCH-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
   11.1883   -9.2485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7124   -9.8730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4219  -10.2817    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.4219  -11.0986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7124  -11.5151    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.0071  -11.0986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0071  -10.2817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3001   -9.8728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5515  -10.2036    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.0091   -9.5933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4168   -8.8855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2154   -9.0581    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.2942  -11.5073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2942  -12.3223    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.5835  -12.7238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5835  -13.5449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2913  -13.9603    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.0019  -13.5508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0019  -12.7298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1273  -11.5073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8780  -11.1716    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   14.4201  -11.7785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0168  -12.4888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2172  -12.3172    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.2366   -9.2485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9539   -8.4793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4857   -7.8569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2926   -8.0014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5677   -8.7685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0435   -9.3931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8207   -7.3761    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  4  3  2  0
  5  4  1  0
  6  5  1  0
  7  6  2  0
  2  7  1  0
  7  8  1  0
  8  9  1  0
 10  9  1  0
 11 10  2  0
 12 11  1  0
  8 12  2  0
  6 13  1  0
 13 14  1  0
 14 15  1  0
 16 15  1  0
 17 16  1  0
 18 17  1  0
 19 18  1  0
 14 19  1  0
  4 20  1  0
 20 21  1  0
 22 21  1  0
 23 22  2  0
 24 23  1  0
 20 24  2  0
  2 25  1  0
 25 26  2  0
 27 26  1  0
 28 27  2  0
 29 28  1  0
 30 29  2  0
 25 30  1  0
 28 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4513853

    ---

Associated Targets(non-human)

Hepatitis B virus (7925 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 439.52Molecular Weight (Monoisotopic): 439.1478AlogP: 3.28#Rotatable Bonds: 5
Polar Surface Area: 75.78Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.80CX LogP: 2.12CX LogD: 2.12
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.66Np Likeness Score: -1.24

References

1. Qiu Z, Lin X, Zhou M, Liu Y, Zhu W, Chen W, Zhang W, Guo L, Liu H, Wu G, Huang M, Jiang M, Xu Z, Zhou Z, Qin N, Ren S, Qiu H, Zhong S, Zhang Y, Zhang Y, Wu X, Shi L, Shen F, Mao Y, Zhou X, Yang W, Wu JZ, Yang G, Mayweg AV, Shen HC, Tang G..  (2016)  Design and Synthesis of Orally Bioavailable 4-Methyl Heteroaryldihydropyrimidine Based Hepatitis B Virus (HBV) Capsid Inhibitors.,  59  (16): [PMID:27458651] [10.1021/acs.jmedchem.6b00879]

Source