The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-Cyanophenyl)-2-(3-(6-methylpyridin-2-yl)-4-(thieno[3,2-c]pyridin-2-yl)-1H-pyrazol-1-yl)ethanethioamide ID: ALA4513885
PubChem CID: 155539034
Max Phase: Preclinical
Molecular Formula: C25H18N6S2
Molecular Weight: 466.60
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cccc(-c2nn(CC(=S)Nc3cccc(C#N)c3)cc2-c2cc3cnccc3s2)n1
Standard InChI: InChI=1S/C25H18N6S2/c1-16-4-2-7-21(28-16)25-20(23-11-18-13-27-9-8-22(18)33-23)14-31(30-25)15-24(32)29-19-6-3-5-17(10-19)12-26/h2-11,13-14H,15H2,1H3,(H,29,32)
Standard InChI Key: UWGGOJHRAMGQCH-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
18.1676 -3.8773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8764 -4.2824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9631 -5.0949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7628 -5.2636 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.1703 -4.5552 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.6224 -3.9489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3585 -5.6399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5806 -5.3865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9756 -5.9304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1427 -6.7307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9206 -6.9841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5314 -6.4373 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.0890 -7.7838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9870 -4.5523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3980 -5.2586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2152 -5.2557 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.9919 -5.9677 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
22.6263 -5.9620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2177 -6.6683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6281 -7.3741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4461 -7.3717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8521 -6.6576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4393 -5.9547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0766 -3.0655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4212 -4.2124 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
16.8721 -3.6082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2781 -2.9041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8714 -2.2025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0589 -2.2038 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.6548 -2.9126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0638 -3.6112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6683 -6.6487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4855 -6.6429 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 1 0
6 2 2 0
1 2 1 0
7 8 2 0
7 12 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
3 7 1 0
11 13 1 0
5 14 1 0
14 15 1 0
15 16 1 0
15 17 2 0
16 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
1 24 2 0
24 27 1 0
26 25 1 0
25 1 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
32 33 3 0
22 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 466.60Molecular Weight (Monoisotopic): 466.1034AlogP: 5.84#Rotatable Bonds: 5Polar Surface Area: 79.42Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.37CX Basic pKa: 3.67CX LogP: 4.69CX LogD: 4.69Aromatic Rings: 5Heavy Atoms: 33QED Weighted: 0.33Np Likeness Score: -1.86
References 1. Zhu WJ, Cui BW, Wang HM, Nan JX, Piao HR, Lian LH, Jin CH.. (2019) Design, synthesis, and antifibrosis evaluation of 4-(benzo-[c][1,2,5]thiadiazol-5-yl)-3(5)-(6-methyl- pyridin-2-yl)pyrazole and 3(5)-(6-methylpyridin- 2-yl)-4-(thieno-[3,2,-c]pyridin-2-yl)pyrazole derivatives., 180 [PMID:31299584 ] [10.1016/j.ejmech.2019.07.013 ]