1-(Mesitylsulfonyl)-4-(naphthalen-2-yloxy)piperidine

ID: ALA4513891

PubChem CID: 155539049

Max Phase: Preclinical

Molecular Formula: C24H27NO3S

Molecular Weight: 409.55

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cc(C)c(S(=O)(=O)N2CCC(Oc3ccc4ccccc4c3)CC2)c(C)c1

Standard InChI:  InChI=1S/C24H27NO3S/c1-17-14-18(2)24(19(3)15-17)29(26,27)25-12-10-22(11-13-25)28-23-9-8-20-6-4-5-7-21(20)16-23/h4-9,14-16,22H,10-13H2,1-3H3

Standard InChI Key:  PCZTVTBJAZESED-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   34.0744  -13.3021    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.4871  -14.0119    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   34.8955  -13.2996    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.7811  -14.4247    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.1966  -14.4247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1915  -15.2465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9001  -15.6591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6133  -15.2510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6133  -14.4260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9041  -14.0171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4818  -15.6516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3202  -15.6610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9043  -13.1999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0730  -14.0137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3691  -14.4230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3693  -15.2411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0796  -15.6483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7897  -15.2374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6623  -15.6509    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.9539  -15.2434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9550  -14.4267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2475  -14.0194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2516  -15.6543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5435  -15.2506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5430  -14.4314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8344  -14.0240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1258  -14.4347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1303  -15.2571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8395  -15.6607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  2  1  0
  2  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  6 11  1  0
  8 12  1  0
 10 13  1  0
  4 14  1  0
  4 18  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 16 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 25  2  0
 24 23  2  0
 23 20  1  0
 24 25  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4513891

    ---

Associated Targets(Human)

RAPGEF3 Tchem Rap guanine nucleotide exchange factor 3 (15528 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 409.55Molecular Weight (Monoisotopic): 409.1712AlogP: 5.00#Rotatable Bonds: 4
Polar Surface Area: 46.61Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 5.21CX LogD: 5.21
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.61Np Likeness Score: -0.98

References

1. Wang P, Luchowska-Stańska U, van Basten B, Chen H, Liu Z, Wiejak J, Whelan P, Morgan D, Lochhead E, Barker G, Rehmann H, Yarwood SJ, Zhou J..  (2020)  Synthesis and Biochemical Evaluation of Noncyclic Nucleotide Exchange Proteins Directly Activated by cAMP 1 (EPAC1) Regulators.,  63  (10): [PMID:32340447] [10.1021/acs.jmedchem.9b02094]

Source