2-(4-Ethoxyphenyl)-9-(2-methoxyphenyl)-7-methyl-8-oxo-8,9-dihydro-7H-purine-6-carboxamide

ID: ALA4513896

PubChem CID: 130298889

Max Phase: Preclinical

Molecular Formula: C22H21N5O4

Molecular Weight: 419.44

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOc1ccc(-c2nc(C(N)=O)c3c(n2)n(-c2ccccc2OC)c(=O)n3C)cc1

Standard InChI:  InChI=1S/C22H21N5O4/c1-4-31-14-11-9-13(10-12-14)20-24-17(19(23)28)18-21(25-20)27(22(29)26(18)2)15-7-5-6-8-16(15)30-3/h5-12H,4H2,1-3H3,(H2,23,28)

Standard InChI Key:  MQOBSERGANIOJG-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   36.0180  -24.7495    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.7277  -24.3401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7249  -23.5174    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.0163  -23.1122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3100  -24.3406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3112  -23.5195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5307  -23.2646    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.0470  -23.9282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5287  -24.5931    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.2781  -25.3652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4817  -25.5311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2303  -26.2992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7708  -26.9054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5661  -26.7381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8209  -25.9646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.4361  -24.7476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0103  -22.2953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7149  -21.8815    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.4325  -25.5651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.1400  -25.9725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.8481  -25.5628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.8441  -24.7414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.1361  -24.3377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2299  -23.9270    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.5569  -25.9693    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.5593  -26.7865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.2682  -27.1930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2996  -21.8919    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.2794  -22.4870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6204  -25.7952    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.1668  -26.4028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  5  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9  5  1  0
  9 10  1  0
 10 11  2  0
 10 15  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
  2 16  1  0
  4 17  1  0
 17 18  1  0
 16 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 16  1  0
  8 24  2  0
 21 25  1  0
 25 26  1  0
 26 27  1  0
 17 28  2  0
  7 29  1  0
 15 30  1  0
 30 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4513896

    ---

Associated Targets(Human)

NCI-H1975 (4994 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 419.44Molecular Weight (Monoisotopic): 419.1594AlogP: 2.29#Rotatable Bonds: 6
Polar Surface Area: 114.26Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 13.04CX Basic pKa: CX LogP: 3.58CX LogD: 3.58
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.51Np Likeness Score: -1.23

References

1. Huang MR, Hsu YL, Lin TC, Cheng TJ, Li LW, Tseng YW, Chou YS, Liu JH, Pan SH, Fang JM, Wong CH..  (2019)  Structure-guided development of purine amide, hydroxamate, and amidoxime for the inhibition of non-small cell lung cancer.,  181  [PMID:31376567] [10.1016/j.ejmech.2019.07.054]

Source