The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Benzylsulfonyl-4-bromo-N-(2-hydroxyethyl)-5-sulfamoylbenzamide ID: ALA4513913
PubChem CID: 126509348
Max Phase: Preclinical
Molecular Formula: C16H17BrN2O6S2
Molecular Weight: 477.36
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: NS(=O)(=O)c1cc(C(=O)NCCO)c(S(=O)(=O)Cc2ccccc2)cc1Br
Standard InChI: InChI=1S/C16H17BrN2O6S2/c17-13-9-14(26(22,23)10-11-4-2-1-3-5-11)12(16(21)19-6-7-20)8-15(13)27(18,24)25/h1-5,8-9,20H,6-7,10H2,(H,19,21)(H2,18,24,25)
Standard InChI Key: PYLVVDNHUGVMGF-UHFFFAOYSA-N
Molfile:
RDKit 2D
27 28 0 0 0 0 0 0 0 0999 V2000
24.9356 -3.8885 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.5311 -4.5984 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
25.3481 -4.5937 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.5349 -5.4163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2435 -5.8216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2464 -6.6442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5367 -7.0537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8287 -6.6447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8298 -5.8252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5365 -7.8709 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
23.8287 -8.2793 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.9458 -8.5798 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.3544 -7.8709 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.9497 -5.4103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6589 -5.8162 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.9466 -4.5931 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.8236 -4.1926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3651 -5.4050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0744 -5.8109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7805 -5.3996 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.1206 -7.0527 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
23.8212 -3.3754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5264 -2.9674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5243 -2.1509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8149 -1.7436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1061 -2.1586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1116 -2.9737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 2 1 0
5 4 2 0
6 5 1 0
7 6 2 0
8 7 1 0
9 8 2 0
4 9 1 0
7 10 1 0
10 11 1 0
10 12 2 0
10 13 2 0
5 14 1 0
14 15 1 0
14 16 2 0
2 17 1 0
15 18 1 0
18 19 1 0
19 20 1 0
8 21 1 0
17 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 477.36Molecular Weight (Monoisotopic): 475.9711AlogP: 0.79#Rotatable Bonds: 7Polar Surface Area: 143.63Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.41CX Basic pKa: ┄CX LogP: 0.45CX LogD: 0.41Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.54Np Likeness Score: -1.29
References 1. Zakšauskas A, Čapkauskaitė E, Jezepčikas L, Linkuvienė V, Paketurytė V, Smirnov A, Leitans J, Kazaks A, Dvinskis E, Manakova E, Gražulis S, Tars K, Matulis D.. (2020) Halogenated and di-substituted benzenesulfonamides as selective inhibitors of carbonic anhydrase isoforms., 185 [PMID:31740053 ] [10.1016/j.ejmech.2019.111825 ]