(R)-Ganocapenoid D

ID: ALA4513934

PubChem CID: 155539153

Max Phase: Preclinical

Molecular Formula: C16H18O5

Molecular Weight: 290.31

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C/C(=C/CCC1=C[C@H](c2cc(O)ccc2O)OC1=O)CO

Standard InChI:  InChI=1S/C16H18O5/c1-10(9-17)3-2-4-11-7-15(21-16(11)20)13-8-12(18)5-6-14(13)19/h3,5-8,15,17-19H,2,4,9H2,1H3/b10-3-/t15-/m1/s1

Standard InChI Key:  FMWDHZPVFRVQMU-ITOFIOBYSA-N

Molfile:  

 
     RDKit          2D

 21 22  0  0  0  0  0  0  0  0999 V2000
    2.7828  -12.6456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7816  -13.4729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4964  -13.8858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2129  -13.4725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2101  -12.6419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4947  -12.2328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4962  -14.7108    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4922  -11.4078    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9229  -12.2267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6775  -12.5569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2273  -11.9417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8120  -11.2288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0057  -11.4035    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.9417  -12.3542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6562  -11.9417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1447  -10.4738    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.3707  -12.3542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0851  -11.9417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7996  -12.3542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0851  -11.1167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7996  -10.7043    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  3  7  1  0
  6  8  1  0
  9  5  1  6
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  1  0
 13  9  1  0
 14 15  1  0
 14 11  1  0
 12 16  2  0
 15 17  1  0
 17 18  2  0
 18 19  1  0
 18 20  1  0
 20 21  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4513934

    ---

Associated Targets(non-human)

PC-12 (7051 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 290.31Molecular Weight (Monoisotopic): 290.1154AlogP: 2.34#Rotatable Bonds: 5
Polar Surface Area: 86.99Molecular Species: NEUTRALHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 9.32CX Basic pKa: CX LogP: 2.49CX LogD: 2.48
Aromatic Rings: 1Heavy Atoms: 21QED Weighted: 0.44Np Likeness Score: 3.03

References

1. Liao GF, Wu ZH, Liu Y, Yan YM, Lu RM, Cheng YX..  (2019)  Ganocapenoids A-D: Four new aromatic meroterpenoids from Ganoderma capense.,  29  (2): [PMID:30527867] [10.1016/j.bmcl.2018.12.011]

Source