(1R,2R,4aS,5R,8aS)-5-(3-(4-fluorophenyl)allyl)-1-(hydroxymethyl)-1,4a-dimethyl-6-methylenedecahydronaphthalen-2-ol

ID: ALA4513945

PubChem CID: 155539035

Max Phase: Preclinical

Molecular Formula: C23H31FO2

Molecular Weight: 358.50

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C=C1CC[C@@H]2[C@](C)(CO)[C@H](O)CC[C@@]2(C)[C@@H]1C/C=C/c1ccc(F)cc1

Standard InChI:  InChI=1S/C23H31FO2/c1-16-7-12-20-22(2,14-13-21(26)23(20,3)15-25)19(16)6-4-5-17-8-10-18(24)11-9-17/h4-5,8-11,19-21,25-26H,1,6-7,12-15H2,2-3H3/b5-4+/t19-,20+,21-,22+,23+/m1/s1

Standard InChI Key:  CLLLDFJAMNJCBN-MRWRQJMSSA-N

Molfile:  

 
     RDKit          2D

 27 29  0  0  0  0  0  0  0  0999 V2000
   30.2485  -18.7376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8440  -18.0277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4309  -18.7350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9795  -15.1717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9795  -14.3462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2676  -15.5803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2676  -16.4016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2599  -18.0396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9695  -17.6322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9731  -16.8083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5499  -17.6272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5542  -16.8131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8546  -16.4025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1463  -16.8057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1420  -17.6198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6848  -16.3954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5497  -15.9889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5456  -18.4446    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   28.4280  -18.0247    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.8376  -19.4481    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.6872  -13.9377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3947  -14.3488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1019  -13.9408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1023  -13.1228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3896  -12.7143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6853  -13.1246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8095  -12.7132    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  1  1
  4  5  2  0
  4  6  1  0
  7  6  1  6
  7 12  1  0
  7 10  1  0
 11  8  1  0
  8  9  1  0
  9 10  1  0
 11 12  1  0
 11  2  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15  2  1  0
 10 16  2  0
 12 17  1  6
 11 18  1  1
 15 19  1  6
  1 20  1  0
  5 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 24 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4513945

    ---

Associated Targets(Human)

DU-145 (51482 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 358.50Molecular Weight (Monoisotopic): 358.2308AlogP: 4.97#Rotatable Bonds: 4
Polar Surface Area: 40.46Molecular Species: NEUTRALHBA: 2HBD: 2
#RO5 Violations: HBA (Lipinski): 2HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 4.60CX LogD: 4.60
Aromatic Rings: 1Heavy Atoms: 26QED Weighted: 0.75Np Likeness Score: 2.08

References

1. Kandanur SGS, Tamang N, Golakoti NR, Nanduri S..  (2019)  Andrographolide: A natural product template for the generation of structurally and biologically diverse diterpenes.,  176  [PMID:31151068] [10.1016/j.ejmech.2019.05.022]

Source