The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
NA ID: ALA4513950
PubChem CID: 155539054
Max Phase: Preclinical
Molecular Formula: C32H33NO11
Molecular Weight: 607.61
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc([C@@]23Oc4cc5c(c(OC)c4[C@]2(O)[C@H](O)[C@H](C(N)=O)[C@H]3c2ccccc2)[C@@H]2OC[C@H]([C@@H](O)CO)O[C@@H]2O5)cc1
Standard InChI: InChI=1S/C32H33NO11/c1-39-17-10-8-16(9-11-17)32-24(15-6-4-3-5-7-15)23(29(33)37)28(36)31(32,38)25-20(44-32)12-19-22(26(25)40-2)27-30(42-19)43-21(14-41-27)18(35)13-34/h3-12,18,21,23-24,27-28,30,34-36,38H,13-14H2,1-2H3,(H2,33,37)/t18-,21+,23+,24+,27-,28+,30-,31-,32-/m0/s1
Standard InChI Key: RWLOCAODKRONHD-PHCMLFBASA-N
Molfile:
RDKit 2D
47 53 0 0 0 0 0 0 0 0999 V2000
7.5442 -12.9391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5415 -11.2999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2570 -11.7067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2601 -12.5303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0421 -12.7769 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0345 -11.4485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5272 -12.1083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3034 -11.8488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2968 -11.0253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5139 -10.7761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6198 -10.7305 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.9279 -12.8144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0946 -12.0574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5169 -13.5181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9166 -14.2276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7315 -14.2300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1441 -13.5222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7388 -12.8170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3028 -12.8462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0928 -13.0550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6694 -12.4790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4501 -11.6877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6607 -11.4782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0031 -10.6058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7140 -11.0093 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.9909 -9.7885 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.2529 -10.0039 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5419 -10.4784 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8301 -10.0720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1438 -14.9421 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7284 -15.6479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8336 -12.5329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8328 -11.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0585 -12.7900 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5743 -12.1252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0500 -11.4611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7188 -10.7197 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9041 -10.6370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4262 -11.2970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7610 -12.0479 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6036 -11.2941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2000 -10.5806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3785 -10.5777 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1920 -12.0048 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0091 -12.0075 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
5.1571 -12.8310 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
6.6295 -10.8761 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
32 1 1 0
1 4 2 0
3 2 2 0
2 33 1 0
3 4 1 0
4 5 1 0
5 7 1 0
6 3 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 6 1 0
6 11 1 1
7 12 1 1
8 13 1 1
12 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 12 1 0
13 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 13 1 0
9 24 1 6
24 25 1 0
24 26 2 0
10 27 1 6
2 28 1 0
28 29 1 0
16 30 1 0
30 31 1 0
32 33 2 0
33 36 1 0
35 34 1 0
34 32 1 0
35 36 1 0
35 40 1 0
36 37 1 0
37 38 1 0
38 39 1 0
39 40 1 0
39 41 1 0
41 42 1 0
42 43 1 0
41 44 1 1
39 45 1 6
35 46 1 6
36 47 1 6
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 607.61Molecular Weight (Monoisotopic): 607.2054AlogP: 0.97#Rotatable Bonds: 7Polar Surface Area: 179.39Molecular Species: NEUTRALHBA: 11HBD: 5#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 6#RO5 Violations (Lipinski): 3CX Acidic pKa: 11.59CX Basic pKa: ┄CX LogP: 0.55CX LogD: 0.55Aromatic Rings: 3Heavy Atoms: 44QED Weighted: 0.26Np Likeness Score: 1.85
References 1. Agarwal G, Wilson JR, Kurina SJ, Anaya-Eugenio GD, Ninh TN, Burdette JE, Soejarto DD, Cheng X, Carcache de Blanco EJ, Rakotondraibe LH, Kinghorn AD.. (2019) Structurally Modified Cyclopenta[b]benzofuran Analogues Isolated from Aglaia perviridis., 82 (10): [PMID:31621322 ] [10.1021/acs.jnatprod.9b00631 ]