N-(3-(benzo[d]thiazol-2-yl)-6-isopropyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl)-3-(phenylamino)propanamide

ID: ALA4514024

PubChem CID: 124117931

Max Phase: Preclinical

Molecular Formula: C26H28N4OS2

Molecular Weight: 476.67

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)N1CCc2c(sc(NC(=O)CCNc3ccccc3)c2-c2nc3ccccc3s2)C1

Standard InChI:  InChI=1S/C26H28N4OS2/c1-17(2)30-15-13-19-22(16-30)33-26(24(19)25-28-20-10-6-7-11-21(20)32-25)29-23(31)12-14-27-18-8-4-3-5-9-18/h3-11,17,27H,12-16H2,1-2H3,(H,29,31)

Standard InChI Key:  KISDLSQOBMVXHF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
    7.3554   -8.5808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7501   -8.0332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9718   -8.2874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1865   -9.3826    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.1379   -8.3307    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.3069   -7.5289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0537   -7.1975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9686   -6.3806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1668   -6.2117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9126   -5.4333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4643   -4.8239    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.2619   -4.9929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5161   -5.7712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2100   -4.0456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4082   -3.8766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7576   -3.4362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7593   -6.9195    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    9.7615   -7.6050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5083   -7.2694    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   11.0600   -7.8788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6484   -8.5907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8508   -8.4177    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.0600   -9.2985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8750   -9.2985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2866   -8.5907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8750   -7.8788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3637   -7.7415    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.5869   -7.9952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9814   -7.4460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2052   -7.6991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0359   -8.4995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6489   -9.0462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4227   -8.7902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  1  4  2  0
  1  5  1  0
  5  6  1  0
  7  6  2  0
  8  7  1  0
  9  8  2  0
 10  9  1  0
 10 11  1  0
 12 11  1  0
 13 12  1  0
  8 13  1  0
 11 14  1  0
 14 15  1  0
 14 16  1  0
  9 17  1  0
  6 17  1  0
  7 18  1  0
 19 18  1  0
 19 20  1  0
 21 20  1  0
 22 21  1  0
 18 22  2  0
 21 23  2  0
 24 23  1  0
 25 24  2  0
 26 25  1  0
 20 26  2  0
  3 27  1  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4514024

    ---

Associated Targets(Human)

MYC Tchem Myc proto-oncogene protein (1178 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NCI-H2171 (837 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 476.67Molecular Weight (Monoisotopic): 476.1705AlogP: 6.23#Rotatable Bonds: 7
Polar Surface Area: 57.26Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.48CX Basic pKa: 7.52CX LogP: 5.59CX LogD: 5.23
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.33Np Likeness Score: -2.06

References

1.  (2018)  Compounds for the modulation of myc activity, 

Source