3-(1-(4-(4-methoxyphenyl)thiazol-2-yl)-3-methyl-1H-pyrazol-5-yl)-2H-chromen-2-one

ID: ALA4514120

PubChem CID: 129833343

Max Phase: Preclinical

Molecular Formula: C23H17N3O3S

Molecular Weight: 415.47

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(-c2csc(-n3nc(C)cc3-c3cc4ccccc4oc3=O)n2)cc1

Standard InChI:  InChI=1S/C23H17N3O3S/c1-14-11-20(18-12-16-5-3-4-6-21(16)29-22(18)27)26(25-14)23-24-19(13-30-23)15-7-9-17(28-2)10-8-15/h3-13H,1-2H3

Standard InChI Key:  NAKSEEFOJVRTGP-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 34  0  0  0  0  0  0  0  0999 V2000
    2.4303  -32.8591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4292  -33.6786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1372  -34.0876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1354  -32.4502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8440  -32.8555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8474  -33.6807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5598  -34.0881    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2734  -33.6748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2700  -32.8496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5530  -32.4377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9822  -34.0815    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9816  -32.4376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7292  -32.7677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2741  -32.1587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8633  -31.4522    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0646  -31.6247    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.4582  -31.0794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5411  -30.2664    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7935  -29.9364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2486  -30.5455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6595  -31.2518    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.0894  -32.1552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7876  -29.1176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4961  -28.7049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4905  -27.8869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7779  -27.4818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0694  -27.9007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0785  -28.7174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7710  -26.6646    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4752  -26.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
  8 11  2  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 12  1  0
  9 12  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 17  1  0
 16 17  1  0
 14 22  1  0
 19 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 26 29  1  0
 29 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4514120

    ---

Associated Targets(Human)

MCF7 (126967 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 415.47Molecular Weight (Monoisotopic): 415.0991AlogP: 5.09#Rotatable Bonds: 4
Polar Surface Area: 70.15Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 1.44CX LogP: 4.81CX LogD: 4.81
Aromatic Rings: 5Heavy Atoms: 30QED Weighted: 0.38Np Likeness Score: -1.35

References

1. Zhang L, Xu Z..  (2019)  Coumarin-containing hybrids and their anticancer activities.,  181  [PMID:31404864] [10.1016/j.ejmech.2019.111587]

Source