(6-(((4-tert-Butylcyclohexyl)methyl)(pyridine-3-ylsulfonyl)-aminomethyl)pyridin-2-amino)acetic Acid Hydrochloride

ID: ALA4514124

PubChem CID: 155539237

Max Phase: Preclinical

Molecular Formula: C24H35ClN4O4S

Molecular Weight: 474.63

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)(C)C1CCC(CN(Cc2cccc(NCC(=O)O)n2)S(=O)(=O)c2cccnc2)CC1.Cl

Standard InChI:  InChI=1S/C24H34N4O4S.ClH/c1-24(2,3)19-11-9-18(10-12-19)16-28(33(31,32)21-7-5-13-25-14-21)17-20-6-4-8-22(27-20)26-15-23(29)30;/h4-8,13-14,18-19H,9-12,15-17H2,1-3H3,(H,26,27)(H,29,30);1H

Standard InChI Key:  ORMRPTOZFKDFDZ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 35  0  0  0  0  0  0  0  0999 V2000
   13.5241   -3.9482    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   11.8917   -6.3334    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.0667   -6.3334    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   11.4792   -7.0478    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.9277   -6.7542    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.9266   -7.5815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6414   -7.9944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3537   -7.5811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3508   -6.7505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6396   -6.3413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0648   -5.5104    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.7777   -5.0951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3488   -5.1005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3457   -4.2755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4938   -5.5049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0604   -3.8623    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6258   -3.0471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6321   -3.8699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3411   -2.6275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0547   -3.0356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7668   -2.6193    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.4836   -3.0279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1957   -2.6115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9124   -3.0201    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.1913   -1.7865    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.4927   -6.3347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2045   -6.7444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9199   -6.3327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9188   -5.5067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2023   -5.0924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6344   -6.7452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6344   -7.5702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3488   -6.3328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3459   -7.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  2  0
  4  3  2  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  9  3  1  0
  3 11  1  0
 11 12  1  0
 11 13  1  0
 13 14  1  0
 12 15  1  0
 14 16  2  0
 16 20  1  0
 19 17  1  0
 17 18  2  0
 18 14  1  0
 19 20  2  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  2  0
 23 25  1  0
 15 26  1  0
 15 30  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 28 31  1  0
 31 32  1  0
 31 33  1  0
 31 34  1  0
M  END

Associated Targets(Human)

PTGER2 Tclin Prostanoid EP2 receptor (1730 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 474.63Molecular Weight (Monoisotopic): 474.2301AlogP: 4.02#Rotatable Bonds: 9
Polar Surface Area: 112.49Molecular Species: ACIDHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 3.04CX Basic pKa: 5.67CX LogP: 1.36CX LogD: 0.04
Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.56Np Likeness Score: -1.43

References

1. Iwamura R, Tanaka M, Okanari E, Kirihara T, Odani-Kawabata N, Shams N, Yoneda K..  (2018)  Identification of a Selective, Non-Prostanoid EP2 Receptor Agonist for the Treatment of Glaucoma: Omidenepag and its Prodrug Omidenepag Isopropyl.,  61  (15): [PMID:29995405] [10.1021/acs.jmedchem.8b00808]

Source