The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-(6-chlorothiazolo[4,5-c]pyridin-2-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl)-3-(2-methoxyethylamino)propanamide ID: ALA4514141
PubChem CID: 124120188
Max Phase: Preclinical
Molecular Formula: C19H22ClN5O2S2
Molecular Weight: 452.01
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COCCNCCC(=O)Nc1sc2c(c1-c1nc3cnc(Cl)cc3s1)CCNC2
Standard InChI: InChI=1S/C19H22ClN5O2S2/c1-27-7-6-21-5-3-16(26)25-19-17(11-2-4-22-10-14(11)29-19)18-24-12-9-23-15(20)8-13(12)28-18/h8-9,21-22H,2-7,10H2,1H3,(H,25,26)
Standard InChI Key: CVUDRVZSAWYXKU-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 32 0 0 0 0 0 0 0 0999 V2000
26.2350 -4.0221 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.8206 -3.3111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9994 -3.3164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5919 -4.0248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7915 -4.2039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1517 -3.6822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3478 -3.8527 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.9394 -3.1373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4828 -2.5385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2363 -1.7540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4348 -1.5774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8963 -2.1914 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.1429 -2.9648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2370 -2.8661 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
23.7072 -5.0232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4548 -5.3511 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
25.0019 -4.7398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8221 -4.7371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0001 -5.4352 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.0007 -6.2541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2845 -6.6707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2851 -7.4896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5689 -7.9020 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.7120 -6.6660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.5680 -8.7192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8599 -9.1270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8590 -9.9442 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.1508 -10.3520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1801 -0.8009 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 3 1 0
4 5 1 0
5 6 1 0
6 7 2 0
8 7 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
13 12 2 0
13 8 1 0
9 14 1 0
14 6 1 0
5 15 2 0
15 16 1 0
17 16 1 0
17 4 2 0
18 17 1 0
18 1 1 0
19 15 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
20 24 2 0
23 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
11 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 452.01Molecular Weight (Monoisotopic): 451.0903AlogP: 3.28#Rotatable Bonds: 8Polar Surface Area: 88.17Molecular Species: BASEHBA: 8HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.51CX Basic pKa: 9.13CX LogP: 2.18CX LogD: -0.36Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.36Np Likeness Score: -1.88
References 1. (2018) Compounds for the modulation of myc activity,