The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Amino-N-{2-chloro-5-[2-(piperidin-4-yloxy)pyrimidin-5-yl]phenyl}-1,3-oxazole-4-carboxamide ID: ALA4514185
PubChem CID: 135186883
Max Phase: Preclinical
Molecular Formula: C19H19ClN6O3
Molecular Weight: 414.85
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Nc1nc(C(=O)Nc2cc(-c3cnc(OC4CCNCC4)nc3)ccc2Cl)co1
Standard InChI: InChI=1S/C19H19ClN6O3/c20-14-2-1-11(7-15(14)25-17(27)16-10-28-18(21)26-16)12-8-23-19(24-9-12)29-13-3-5-22-6-4-13/h1-2,7-10,13,22H,3-6H2,(H2,21,26)(H,25,27)
Standard InChI Key: XRCGBJGLLLFZPH-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 32 0 0 0 0 0 0 0 0999 V2000
10.3613 -10.0824 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7346 -9.0378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5285 -8.1604 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.6148 -8.6618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4895 -9.8317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6594 -8.0351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6594 -6.8651 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.6622 -8.6618 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.7068 -8.0351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7068 -6.8651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7513 -6.2802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7541 -6.8651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7541 -8.0351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7513 -8.6618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7987 -8.6618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7987 -9.8317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8015 -10.4167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.8461 -9.8317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8461 -8.6618 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.8015 -8.0351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8489 -10.4167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.8934 -9.8317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8962 -10.4167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9408 -9.8317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9408 -8.6618 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.8962 -8.0351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8934 -8.6618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6622 -6.2802 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
8.5647 -8.9125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
1 5 1 0
4 6 1 0
6 7 2 0
6 8 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
9 14 2 0
13 15 1 0
16 15 1 0
17 16 2 0
18 17 1 0
18 19 2 0
20 19 1 0
15 20 2 0
18 21 1 0
21 22 1 0
23 22 1 0
24 23 1 0
25 24 1 0
25 26 1 0
27 26 1 0
22 27 1 0
10 28 1 0
2 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 414.85Molecular Weight (Monoisotopic): 414.1207AlogP: 2.75#Rotatable Bonds: 5Polar Surface Area: 128.19Molecular Species: BASEHBA: 8HBD: 3#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.94CX Basic pKa: 9.82CX LogP: 1.74CX LogD: -0.62Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.58Np Likeness Score: -1.07
References 1. (2018) Oxazole derivatives for use in the treatment of cancer,