4-(1-(3-(2-(Cyclopenta-1,3-dien-1-yl)allyl)-4-ethylphenyl)-ethyl)-2-methylene-1,2-dihydronaphthalene

ID: ALA4514252

PubChem CID: 135265506

Max Phase: Preclinical

Molecular Formula: C22H17NO6

Molecular Weight: 391.38

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(N(C)c2cc(=O)oc3ccccc23)cc1OC(=O)c1ccco1

Standard InChI:  InChI=1S/C22H17NO6/c1-23(16-13-21(24)28-17-7-4-3-6-15(16)17)14-9-10-18(26-2)20(12-14)29-22(25)19-8-5-11-27-19/h3-13H,1-2H3

Standard InChI Key:  PWVIUWXZUBOMAS-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   11.6013  -12.4468    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.8813  -12.0493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1793  -12.4687    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.4635  -12.0753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7615  -12.4947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0415  -12.0972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0276  -11.2802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7296  -10.8566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4496  -11.2542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1515  -10.8306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1335  -10.0095    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.8396   -9.5900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5554   -9.9876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2574   -9.5640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9774   -9.9616    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.6794   -9.5380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3952   -9.9356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4972  -10.7476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3000  -10.9049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6975  -10.1890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1375   -9.5893    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.6613   -8.7169    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.2435   -8.7429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9454   -8.3193    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.9315   -7.5023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5276   -8.3453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8257   -8.7689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4176   -9.6160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8674  -11.2281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  4  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 17 21  1  0
 16 22  2  0
 14 23  2  0
 23 24  1  0
 24 25  1  0
 23 26  1  0
 26 27  2  0
 12 27  1  0
 11 28  1  0
 10 29  2  0
  2 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4514252

    ---

Associated Targets(Human)

SK-OV-3 (52876 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HCT-116 (91556 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HepG2 (196354 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 391.38Molecular Weight (Monoisotopic): 391.1056AlogP: 4.38#Rotatable Bonds: 5
Polar Surface Area: 82.12Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.66CX LogD: 3.66
Aromatic Rings: 4Heavy Atoms: 29QED Weighted: 0.28Np Likeness Score: -0.60

References

1. Cao D, Liu Y, Yan W, Wang C, Bai P, Wang T, Tang M, Wang X, Yang Z, Ma B, Ma L, Lei L, Wang F, Xu B, Zhou Y, Yang T, Chen L..  (2016)  Design, Synthesis, and Evaluation of in Vitro and in Vivo Anticancer Activity of 4-Substituted Coumarins: A Novel Class of Potent Tubulin Polymerization Inhibitors.,  59  (12): [PMID:27213819] [10.1021/acs.jmedchem.6b00158]

Source