4-(3-fluorophenyl)-2-(2-((9-methyl-9H-carbazol-3-yl)methylene)hydrazinyl)thiazole

ID: ALA4514255

PubChem CID: 155539204

Max Phase: Preclinical

Molecular Formula: C23H17FN4S

Molecular Weight: 400.48

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cn1c2ccccc2c2cc(/C=N/Nc3nc(-c4cccc(F)c4)cs3)ccc21

Standard InChI:  InChI=1S/C23H17FN4S/c1-28-21-8-3-2-7-18(21)19-11-15(9-10-22(19)28)13-25-27-23-26-20(14-29-23)16-5-4-6-17(24)12-16/h2-14H,1H3,(H,26,27)/b25-13+

Standard InChI Key:  ANZYHMUBCBXCEF-DHRITJCHSA-N

Molfile:  

 
     RDKit          2D

 29 33  0  0  0  0  0  0  0  0999 V2000
    2.2025   -7.0369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2014   -7.8564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9094   -8.2654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9076   -6.6280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6163   -7.0333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6165   -7.8519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3952   -8.1047    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.3947   -6.7801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8744   -7.4403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6839   -7.3542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0149   -6.6086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5303   -5.9483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7224   -6.0377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8588   -5.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6711   -5.1104    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.9996   -4.3622    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6491   -8.8814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8119   -4.2726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3568   -4.8768    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    9.1017   -4.5406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0120   -3.7283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2118   -3.5626    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6196   -3.1808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3987   -3.4309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0028   -2.8817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8290   -2.0823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0457   -1.8351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4449   -2.3859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7812   -3.1305    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  9  1  0
  8  5  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
 12 14  1  0
 14 15  2  0
 15 16  1  0
  7 17  1  0
 16 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 18  2  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 21 23  1  0
 25 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4514255

    ---

Associated Targets(non-human)

inhA Enoyl-[acyl-carrier-protein] reductase (1329 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 400.48Molecular Weight (Monoisotopic): 400.1158AlogP: 6.04#Rotatable Bonds: 4
Polar Surface Area: 42.21Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.75CX Basic pKa: 5.43CX LogP: 6.66CX LogD: 6.62
Aromatic Rings: 5Heavy Atoms: 29QED Weighted: 0.30Np Likeness Score: -1.78

References

1. Shaikh MS, Kanhed AM, Chandrasekaran B, Palkar MB, Agrawal N, Lherbet C, Hampannavar GA, Karpoormath R..  (2019)  Discovery of novel N-methyl carbazole tethered rhodanine derivatives as direct inhibitors of Mycobacterium tuberculosis InhA.,  29  (16): [PMID:31227345] [10.1016/j.bmcl.2019.06.015]

Source