The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
C0225584 ID: ALA4514287
Cas Number: 1115279-70-3
PubChem CID: 49658516
Max Phase: Preclinical
Molecular Formula: C21H17ClFN5O4S
Molecular Weight: 489.92
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(OC)c(NC(=O)Cn2nc3ccc(Sc4cccc(F)c4)nn3c2=O)cc1Cl
Standard InChI: InChI=1S/C21H17ClFN5O4S/c1-31-16-10-17(32-2)15(9-14(16)22)24-19(29)11-27-21(30)28-18(25-27)6-7-20(26-28)33-13-5-3-4-12(23)8-13/h3-10H,11H2,1-2H3,(H,24,29)
Standard InChI Key: JYUCMUGSPSAABQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
0.2917 -0.7475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6187 -1.4919 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.6267 -2.9927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9282 -3.7385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9331 -5.2385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6365 -5.9928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3350 -5.2470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2977 -5.8504 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.3301 -3.7470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0872 0.0382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8208 1.3475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2072 2.3788 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3215 1.3677 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0552 2.6770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5551 2.6994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3274 1.4125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.5273 1.4321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2857 4.0094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5165 5.2972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0166 5.2749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4012 6.3051 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
6.2860 3.9648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2502 6.6065 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.4500 6.6226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0907 -2.3426 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 3
4 5 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 1 0
11 13 2 0
13 7 1 0
5 14 2 3
14 1 1 0
2 15 2 3
15 16 1 0
16 17 1 0
17 18 1 0
18 19 2 0
18 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 1 0
22 25 1 0
25 26 2 0
26 27 1 0
27 28 1 0
27 29 2 0
29 21 1 0
26 30 1 0
30 31 1 0
16 32 1 0
32 1 1 0
32 33 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 489.92Molecular Weight (Monoisotopic): 489.0674AlogP: 3.49#Rotatable Bonds: 7Polar Surface Area: 99.75Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.48CX Basic pKa: ┄CX LogP: 3.92CX LogD: 3.92Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.42Np Likeness Score: -2.19
References 1. Johannes Zuegg, Alysha Elliott, Maite Amado, Emma Cowie, Ali Hinton, Geraldine Kaeslin, Angela Kavanagh, Anne Kunert, Gabriell Lowe, Soumya Ramu, Janet Reid, Robin Trauer, Mathilde Desselle, Ruth Neale, Karl Hansford, Mark Blascovich, Matthew Cooper. CO-ADD screening of Karazin Kharkiv National University (Ukraine) compounds, [10.6019/CHEMBL4513146 ]