The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-6-(2-chloro-4-methylphenylamino)-4-(4-cyclopropyl-5-(4-isobutylphenyl)isoxazol-3-yl)-6-oxohexanoic acid ID: ALA4514309
PubChem CID: 71135801
Max Phase: Preclinical
Molecular Formula: C29H33ClN2O4
Molecular Weight: 509.05
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(NC(=O)C[C@H](CCC(=O)O)c2noc(-c3ccc(CC(C)C)cc3)c2C2CC2)c(Cl)c1
Standard InChI: InChI=1S/C29H33ClN2O4/c1-17(2)14-19-5-7-21(8-6-19)29-27(20-9-10-20)28(32-36-29)22(11-13-26(34)35)16-25(33)31-24-12-4-18(3)15-23(24)30/h4-8,12,15,17,20,22H,9-11,13-14,16H2,1-3H3,(H,31,33)(H,34,35)/t22-/m0/s1
Standard InChI Key: MTYPXFRCKZFZDI-QFIPXVFZSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
33.3796 -19.3979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3785 -20.2175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0865 -20.6264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7962 -20.2170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7933 -19.3943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0847 -18.9891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0823 -18.1719 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
35.5045 -20.6245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6718 -18.9895 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.9642 -19.3983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2564 -18.9898 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.9644 -20.2155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2568 -20.6242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5483 -20.2195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5488 -19.3986 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.7682 -19.1444 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.2852 -19.8083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7674 -20.4727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5144 -21.2498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9094 -21.7980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6864 -22.0510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4680 -19.8079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2588 -21.4414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9675 -21.8483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6742 -21.4380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3829 -21.8449 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.6722 -20.6208 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.0644 -19.0976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2480 -19.0968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8382 -19.8048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2508 -20.5151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0659 -20.5124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0210 -19.8055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6119 -19.0981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7947 -19.0987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0199 -18.3900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
4 8 1 0
1 9 1 0
9 10 1 0
10 11 2 0
10 12 1 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 1 0
17 18 2 0
18 14 1 0
18 19 1 0
20 19 1 0
21 20 1 0
19 21 1 0
17 22 1 0
13 23 1 6
23 24 1 0
24 25 1 0
25 26 1 0
25 27 2 0
22 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 22 1 0
30 33 1 0
33 34 1 0
34 35 1 0
34 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 509.05Molecular Weight (Monoisotopic): 508.2129AlogP: 7.36#Rotatable Bonds: 11Polar Surface Area: 92.43Molecular Species: ACIDHBA: 4HBD: 2#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 4.67CX Basic pKa: ┄CX LogP: 7.00CX LogD: 4.33Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.28Np Likeness Score: -0.59
References 1. Kotoku M, Maeba T, Fujioka S, Yokota M, Seki N, Ito K, Suwa Y, Ikenogami T, Hirata K, Hase Y, Katsuda Y, Miyagawa N, Arita K, Asahina K, Noguchi M, Nomura A, Doi S, Adachi T, Crowe P, Tao H, Thacher S, Hashimoto H, Suzuki T, Shiozaki M.. (2019) Discovery of Second Generation RORγ Inhibitors Composed of an Azole Scaffold., 62 (5): [PMID:30776227 ] [10.1021/acs.jmedchem.8b01567 ]