(S)-6-(2-chloro-4-methylphenylamino)-4-(4-cyclopropyl-5-(4-isobutylphenyl)isoxazol-3-yl)-6-oxohexanoic acid

ID: ALA4514309

PubChem CID: 71135801

Max Phase: Preclinical

Molecular Formula: C29H33ClN2O4

Molecular Weight: 509.05

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccc(NC(=O)C[C@H](CCC(=O)O)c2noc(-c3ccc(CC(C)C)cc3)c2C2CC2)c(Cl)c1

Standard InChI:  InChI=1S/C29H33ClN2O4/c1-17(2)14-19-5-7-21(8-6-19)29-27(20-9-10-20)28(32-36-29)22(11-13-26(34)35)16-25(33)31-24-12-4-18(3)15-23(24)30/h4-8,12,15,17,20,22H,9-11,13-14,16H2,1-3H3,(H,31,33)(H,34,35)/t22-/m0/s1

Standard InChI Key:  MTYPXFRCKZFZDI-QFIPXVFZSA-N

Molfile:  

 
     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
   33.3796  -19.3979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3785  -20.2175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0865  -20.6264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7962  -20.2170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7933  -19.3943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0847  -18.9891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0823  -18.1719    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   35.5045  -20.6245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6718  -18.9895    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.9642  -19.3983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2564  -18.9898    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.9644  -20.2155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2568  -20.6242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5483  -20.2195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5488  -19.3986    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.7682  -19.1444    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.2852  -19.8083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7674  -20.4727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5144  -21.2498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9094  -21.7980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6864  -22.0510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4680  -19.8079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2588  -21.4414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9675  -21.8483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6742  -21.4380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3829  -21.8449    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.6722  -20.6208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.0644  -19.0976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2480  -19.0968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8382  -19.8048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2508  -20.5151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0659  -20.5124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0210  -19.8055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6119  -19.0981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7947  -19.0987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0199  -18.3900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  4  8  1  0
  1  9  1  0
  9 10  1  0
 10 11  2  0
 10 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 14  1  0
 18 19  1  0
 20 19  1  0
 21 20  1  0
 19 21  1  0
 17 22  1  0
 13 23  1  6
 23 24  1  0
 24 25  1  0
 25 26  1  0
 25 27  2  0
 22 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 22  1  0
 30 33  1  0
 33 34  1  0
 34 35  1  0
 34 36  1  0
M  END

Associated Targets(Human)

RORC Tchem Nuclear receptor ROR-gamma (8495 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 509.05Molecular Weight (Monoisotopic): 508.2129AlogP: 7.36#Rotatable Bonds: 11
Polar Surface Area: 92.43Molecular Species: ACIDHBA: 4HBD: 2
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 4.67CX Basic pKa: CX LogP: 7.00CX LogD: 4.33
Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.28Np Likeness Score: -0.59

References

1. Kotoku M, Maeba T, Fujioka S, Yokota M, Seki N, Ito K, Suwa Y, Ikenogami T, Hirata K, Hase Y, Katsuda Y, Miyagawa N, Arita K, Asahina K, Noguchi M, Nomura A, Doi S, Adachi T, Crowe P, Tao H, Thacher S, Hashimoto H, Suzuki T, Shiozaki M..  (2019)  Discovery of Second Generation RORγ Inhibitors Composed of an Azole Scaffold.,  62  (5): [PMID:30776227] [10.1021/acs.jmedchem.8b01567]

Source