The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-((2,4-dimethylthiazol-5-yl)methylamino)-N-(3-(thiazolo[4,5-c]pyridin-2-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl)propanamide ID: ALA4514347
PubChem CID: 145201757
Max Phase: Preclinical
Molecular Formula: C22H24N6OS3
Molecular Weight: 484.68
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1nc(C)c(CNCCC(=O)Nc2sc3c(c2-c2nc4cnccc4s2)CCNC3)s1
Standard InChI: InChI=1S/C22H24N6OS3/c1-12-17(30-13(2)26-12)10-25-8-5-19(29)28-22-20(14-3-6-24-11-18(14)32-22)21-27-15-9-23-7-4-16(15)31-21/h4,7,9,24-25H,3,5-6,8,10-11H2,1-2H3,(H,28,29)
Standard InChI Key: GRCFRTCPLTYGFR-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
13.8620 -15.0371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1202 -16.1782 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.7206 -14.6952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8698 -15.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7494 -15.1622 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.8987 -15.9646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7783 -15.6291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8488 -16.3379 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
6.8873 -15.6729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2227 -14.5531 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3914 -14.5260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9762 -13.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7576 -15.9756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7224 -14.2423 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.8514 -14.5789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7678 -13.8525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7303 -14.5226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3877 -15.6516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2087 -16.4795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3535 -16.2156 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.6660 -15.1071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8663 -14.2441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2393 -15.6792 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
16.7580 -12.6652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7181 -12.0201 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
17.3666 -10.8931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2142 -10.8880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6189 -9.8443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1994 -8.8438 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.3866 -8.8403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9735 -9.8841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8422 -11.9947 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
1 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
8 7 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 7 2 0
11 12 1 0
9 13 1 0
1 14 1 0
14 15 1 0
16 15 2 0
17 16 1 0
18 17 2 0
19 18 1 0
19 20 1 0
21 20 1 0
22 21 1 0
17 22 1 0
18 23 1 0
15 23 1 0
16 24 1 0
25 24 1 0
26 25 1 0
27 26 2 0
28 27 1 0
28 29 2 0
30 29 1 0
31 30 2 0
26 31 1 0
27 32 1 0
24 32 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 484.68Molecular Weight (Monoisotopic): 484.1174AlogP: 4.26#Rotatable Bonds: 7Polar Surface Area: 91.83Molecular Species: BASEHBA: 9HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.50CX Basic pKa: 8.75CX LogP: 2.35CX LogD: 0.17Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.34Np Likeness Score: -2.05
References 1. (2018) Compounds for the modulation of myc activity,