The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(1-(2-(5-chloro-2,4-dimethoxyphenyl)imidazo[1,2-a]pyridine-7-yl)piperidin-4-yl)ethanamine dihydrochloride ID: ALA4514359
PubChem CID: 154699419
Max Phase: Preclinical
Molecular Formula: C22H29Cl3N4O2
Molecular Weight: 414.94
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(OC)c(-c2cn3ccc(N4CCC(CCN)CC4)cc3n2)cc1Cl.Cl.Cl
Standard InChI: InChI=1S/C22H27ClN4O2.2ClH/c1-28-20-13-21(29-2)18(23)12-17(20)19-14-27-10-6-16(11-22(27)25-19)26-8-4-15(3-7-24)5-9-26;;/h6,10-15H,3-5,7-9,24H2,1-2H3;2*1H
Standard InChI Key: WDEZKNNDCKZSOX-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 32 0 0 0 0 0 0 0 0999 V2000
33.2652 -11.1080 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
30.1726 -11.9472 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.8869 -12.3594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8857 -13.1867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6004 -13.5995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5986 -11.9468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1049 -12.0973 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.3138 -12.3558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3163 -13.1888 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.1101 -13.4424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5952 -12.7654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4188 -12.7599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8347 -13.4735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6587 -13.4692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0678 -12.7519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6470 -12.0377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8244 -12.0455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8910 -12.7510 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.4742 -13.3343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0538 -11.3181 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
34.4167 -14.1841 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.5919 -14.1841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1751 -11.1216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4647 -10.7095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7481 -11.1186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7464 -11.9443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4612 -12.3610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0353 -10.7036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3195 -11.1135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6068 -10.6986 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.2634 -11.0786 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
3 4 1 0
4 5 2 0
5 9 1 0
8 6 1 0
6 3 2 0
8 9 1 0
7 8 2 0
9 10 1 0
10 11 2 0
11 7 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
11 12 1 0
15 18 1 0
18 19 1 0
16 20 1 0
13 21 1 0
21 22 1 0
3 2 1 0
2 23 1 0
2 27 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
25 28 1 0
28 29 1 0
29 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 414.94Molecular Weight (Monoisotopic): 414.1823AlogP: 4.24#Rotatable Bonds: 6Polar Surface Area: 65.02Molecular Species: BASEHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 10.20CX LogP: 3.23CX LogD: 0.63Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.65Np Likeness Score: -1.08
References 1. (2018) Bicyclic compound and use thereof for inhibiting suv39h2,