N-{3-[2-(3,4-Dimethoxyphenoxy)acetamido]phenyl}-4-(dimethylamino)benzamide

ID: ALA4514373

PubChem CID: 155539357

Max Phase: Preclinical

Molecular Formula: C25H27N3O5

Molecular Weight: 449.51

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(OCC(=O)Nc2cccc(NC(=O)c3ccc(N(C)C)cc3)c2)cc1OC

Standard InChI:  InChI=1S/C25H27N3O5/c1-28(2)20-10-8-17(9-11-20)25(30)27-19-7-5-6-18(14-19)26-24(29)16-33-21-12-13-22(31-3)23(15-21)32-4/h5-15H,16H2,1-4H3,(H,26,29)(H,27,30)

Standard InChI Key:  QZXWXWIQVBPALP-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
    6.4803   -6.5412    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4803   -5.7217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7722   -5.3100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7722   -4.4896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0613   -4.0840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3553   -4.4908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6472   -4.0830    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6472   -3.2636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9350   -4.4908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3553   -5.3106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0639   -5.7215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1884   -5.3100    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.8964   -5.7217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8964   -6.5418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6111   -6.9472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3128   -6.5406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3128   -5.7211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0249   -5.3094    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.7330   -5.7211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7330   -6.5406    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.4411   -5.3094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1491   -5.7211    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.8572   -5.3094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5738   -5.7237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2778   -5.3064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9859   -5.7182    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.6981   -5.3064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2778   -4.4927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9836   -4.0851    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.9836   -3.2656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5672   -4.0849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8572   -4.4899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6085   -5.3104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  7  9  1  0
  6 10  2  0
 10 11  1  0
 11  3  2  0
 12  2  1  0
 13 12  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 19 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  1  0
 25 28  1  0
 28 29  1  0
 29 30  1  0
 28 31  2  0
 31 32  1  0
 32 23  2  0
 17 33  1  0
 33 13  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4514373

    ---

Associated Targets(Human)

ROCK1 Tclin Rho-associated protein kinase 1 (4723 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ROCK2 Tclin Rho-associated protein kinase 2 (6206 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 449.51Molecular Weight (Monoisotopic): 449.1951AlogP: 4.04#Rotatable Bonds: 9
Polar Surface Area: 89.13Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 12.48CX Basic pKa: 3.16CX LogP: 3.61CX LogD: 3.61
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.51Np Likeness Score: -1.41

References

1. Zhao L, Li Y, Wang Y, Qiao Z, Miao Z, Yang J, Huang L, Tian C, Li L, Chen D, Yang S..  (2019)  Discovery of 4H-Chromen-4-one Derivatives as a New Class of Selective Rho Kinase (ROCK) Inhibitors, which Showed Potent Activity in ex Vivo Diabetic Retinopathy Models.,  62  (23): [PMID:31693351] [10.1021/acs.jmedchem.9b01143]

Source