The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
methyl 4-(5-chloro-2-((1S)-1-(6-(3-chlorophenyl)-2-oxo-1,3-oxazinan-3-yl)-2-phenylethyl)-1H-imidazol-4-yl)phenylcarbamate ID: ALA4514410
PubChem CID: 155539325
Max Phase: Preclinical
Molecular Formula: C29H26Cl2N4O4
Molecular Weight: 565.46
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)Nc1ccc(-c2nc([C@H](Cc3ccccc3)N3CCC(c4cccc(Cl)c4)OC3=O)[nH]c2Cl)cc1
Standard InChI: InChI=1S/C29H26Cl2N4O4/c1-38-28(36)32-22-12-10-19(11-13-22)25-26(31)34-27(33-25)23(16-18-6-3-2-4-7-18)35-15-14-24(39-29(35)37)20-8-5-9-21(30)17-20/h2-13,17,23-24H,14-16H2,1H3,(H,32,36)(H,33,34)/t23-,24?/m0/s1
Standard InChI Key: KIUZVDHAKFGNAC-UXMRNZNESA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
18.9279 -14.8167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9267 -15.6441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6415 -16.0570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3579 -15.6437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3551 -14.8131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6397 -14.4039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6413 -16.8820 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
21.0655 -14.3980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7814 -14.8100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4921 -14.3983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4933 -13.5730 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.7775 -13.1610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0604 -13.5743 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.2078 -13.1604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9223 -13.5730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0106 -14.3918 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.8176 -14.5633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2301 -13.8488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6779 -13.2358 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.0544 -13.8459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4671 -14.5606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2906 -14.5581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7011 -13.8423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2820 -13.1275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4598 -13.1336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7772 -12.3359 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.2078 -12.3354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9223 -11.9229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6339 -12.3385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3479 -11.9267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3483 -11.1008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6289 -10.6884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9177 -11.1027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1531 -15.3170 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
28.5302 -13.8383 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.9419 -14.5508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7669 -14.5468 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.5371 -15.2672 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.1871 -15.2593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
3 7 1 0
8 9 1 0
8 13 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
5 8 1 0
11 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 15 2 0
18 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
12 26 2 0
14 27 1 1
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
17 34 1 0
23 35 1 0
35 36 1 0
36 37 1 0
36 38 2 0
37 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 565.46Molecular Weight (Monoisotopic): 564.1331AlogP: 7.43#Rotatable Bonds: 7Polar Surface Area: 96.55Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 10.23CX Basic pKa: 3.92CX LogP: 6.43CX LogD: 6.43Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.24Np Likeness Score: -0.61
References 1. Clark CG, Rossi KA, Corte JR, Fang T, Smallheer JM, De Lucca I, Nirschl DS, Orwat MJ, Pinto DJP, Hu Z, Wang Y, Yang W, Jeon Y, Ewing WR, Myers JE, Sheriff S, Lou Z, Bozarth JM, Wu Y, Rendina A, Harper T, Zheng J, Xin B, Xiang Q, Luettgen JM, Seiffert DA, Wexler RR, Lam PYS.. (2019) Structure based design of macrocyclic factor XIa inhibitors: Discovery of cyclic P1 linker moieties with improved oral bioavailability., 29 (19): [PMID:31445854 ] [10.1016/j.bmcl.2019.08.008 ]