The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Diethyl ((4-bromophenyl)(2-(2-((5-(pyridin-4-yl)-1,3,4-oxadiazol-2-yl)thio)acetyl)hydrazinyl)methyl)phosphonate ID: ALA4514419
PubChem CID: 155539375
Max Phase: Preclinical
Molecular Formula: C20H23BrN5O5PS
Molecular Weight: 556.38
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCOP(=O)(OCC)C(NNC(=O)CSc1nnc(-c2ccncc2)o1)c1ccc(Br)cc1
Standard InChI: InChI=1S/C20H23BrN5O5PS/c1-3-29-32(28,30-4-2)19(15-5-7-16(21)8-6-15)25-23-17(27)13-33-20-26-24-18(31-20)14-9-11-22-12-10-14/h5-12,19,25H,3-4,13H2,1-2H3,(H,23,27)
Standard InChI Key: XXRYEMPWTNAGMS-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
18.0169 -10.0112 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.6684 -9.5179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4023 -8.7451 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.5827 -8.7610 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.3486 -9.5431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5800 -9.8120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9618 -9.2759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1905 -9.5436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0362 -10.3470 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.6594 -10.8821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4283 -10.6116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4502 -9.7559 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
20.0471 -9.1978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8289 -9.4358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4259 -8.8778 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.0137 -10.2318 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.2077 -9.1157 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.8047 -8.5577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5864 -8.7957 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
24.1834 -8.2376 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.7712 -9.5917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.5789 -7.9779 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.2828 -7.5628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2752 -6.7456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9652 -8.4756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5622 -7.9175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6208 -7.7663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2195 -7.2085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0352 -6.4132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2527 -6.1745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6545 -6.7374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8418 -7.5306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0669 -5.3787 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 1 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
5 6 1 0
2 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
14 16 2 0
15 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
19 21 2 0
19 22 1 0
22 23 1 0
23 24 1 0
20 25 1 0
25 26 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
18 27 1 0
30 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 556.38Molecular Weight (Monoisotopic): 555.0341AlogP: 4.57#Rotatable Bonds: 12Polar Surface Area: 128.47Molecular Species: NEUTRALHBA: 10HBD: 2#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.41CX Basic pKa: 2.49CX LogP: 2.77CX LogD: 2.77Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.19Np Likeness Score: -1.60
References 1. Ewies EF, El-Hussieny M, El-Sayed NF, Fouad MA.. (2019) Design, synthesis and biological evaluation of novel α-aminophosphonate oxadiazoles via optimized iron triflate catalyzed reaction as apoptotic inducers., 180 [PMID:31323616 ] [10.1016/j.ejmech.2019.07.029 ]