methyl 2',6'-dimethoxy-4-(3-(2-methoxyethoxy)-3-oxopropoxy)biphenyl-3-carboxylate

ID: ALA4514433

PubChem CID: 155539227

Max Phase: Preclinical

Molecular Formula: C22H26O8

Molecular Weight: 418.44

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COCCOC(=O)CCOc1ccc(-c2c(OC)cccc2OC)cc1C(=O)OC

Standard InChI:  InChI=1S/C22H26O8/c1-25-12-13-30-20(23)10-11-29-17-9-8-15(14-16(17)22(24)28-4)21-18(26-2)6-5-7-19(21)27-3/h5-9,14H,10-13H2,1-4H3

Standard InChI Key:  ZQSJRSZIQBGPDV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 31  0  0  0  0  0  0  0  0999 V2000
    3.7029   -8.5270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4186   -8.1166    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4208   -7.2915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1364   -6.8809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7075   -6.8770    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8484   -7.2965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5635   -6.8867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5663   -6.0608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8478   -5.6464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1357   -6.0586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8452   -8.1215    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5581   -8.5368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2742   -8.1272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9870   -8.5425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7031   -8.1327    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.9838   -9.3674    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2677   -9.7772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2644  -10.6021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9772  -11.0175    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.9740  -11.8425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8481   -4.8240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5639   -4.4116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5636   -3.5874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8482   -3.1746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1318   -3.5922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1356   -4.4150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2783   -4.8243    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.9928   -4.4120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4226   -4.8300    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4255   -5.6550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  3  5  2  0
  4  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  4  1  0
  6 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 14 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
  9 21  1  0
 22 27  1  0
 27 28  1  0
 26 29  1  0
 29 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4514433

    ---

Associated Targets(non-human)

Chikungunya virus (1339 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 418.44Molecular Weight (Monoisotopic): 418.1628AlogP: 3.12#Rotatable Bonds: 11
Polar Surface Area: 89.52Molecular Species: NEUTRALHBA: 8HBD:
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 2.96CX LogD: 2.96
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.41Np Likeness Score: -0.41

References

1. Staveness D, Abdelnabi R, Near KE, Nakagawa Y, Neyts J, Delang L, Leyssen P, Wender PA..  (2016)  Inhibition of Chikungunya Virus-Induced Cell Death by Salicylate-Derived Bryostatin Analogues Provides Additional Evidence for a PKC-Independent Pathway.,  79  (4): [PMID:26900711] [10.1021/acs.jnatprod.5b01017]

Source