1-Benzyl-4-(quinolin-3-yl)-1,4-dihydropyridine-3,5-dicarboxamide

ID: ALA4514437

PubChem CID: 155539231

Max Phase: Preclinical

Molecular Formula: C23H20N4O2

Molecular Weight: 384.44

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  NC(=O)C1=CN(Cc2ccccc2)C=C(C(N)=O)C1c1cnc2ccccc2c1

Standard InChI:  InChI=1S/C23H20N4O2/c24-22(28)18-13-27(12-15-6-2-1-3-7-15)14-19(23(25)29)21(18)17-10-16-8-4-5-9-20(16)26-11-17/h1-11,13-14,21H,12H2,(H2,24,28)(H2,25,29)

Standard InChI Key:  YFJBUGZNZNCXBS-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
    4.8528  -12.5814    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1352  -12.1743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4239  -12.5923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4302  -13.4172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7189  -13.8352    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.7252  -14.6602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0139  -15.0781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0201  -15.9031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3088  -16.3210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5912  -15.9140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5850  -15.0890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2963  -14.6711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0013  -13.4281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9950  -12.6032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2774  -12.1961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2711  -11.3712    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.5661  -12.6141    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7063  -12.1852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7000  -11.3603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9824  -10.9532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9761  -10.1282    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.4113  -10.9423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4050  -10.1173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6874   -9.7103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6811   -8.8853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3924   -8.4674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1100   -8.8744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1163   -9.6994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1289  -11.3494    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
  7 12  1  0
  5 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  1  0
 15 17  2  0
 14 18  1  0
  3 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
 19 22  2  0
 22 23  1  0
 23 24  2  0
 21 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 23 28  1  0
  2 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4514437

    ---

Associated Targets(Human)

SIRT1 Tchem NAD-dependent deacetylase sirtuin 1 (3505 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 384.44Molecular Weight (Monoisotopic): 384.1586AlogP: 2.57#Rotatable Bonds: 5
Polar Surface Area: 102.31Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.20CX LogP: 1.62CX LogD: 1.62
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.71Np Likeness Score: -0.60

References

1. Valente S, Mellini P, Spallotta F, Carafa V, Nebbioso A, Polletta L, Carnevale I, Saladini S, Trisciuoglio D, Gabellini C, Tardugno M, Zwergel C, Cencioni C, Atlante S, Moniot S, Steegborn C, Budriesi R, Tafani M, Del Bufalo D, Altucci L, Gaetano C, Mai A..  (2016)  1,4-Dihydropyridines Active on the SIRT1/AMPK Pathway Ameliorate Skin Repair and Mitochondrial Function and Exhibit Inhibition of Proliferation in Cancer Cells.,  59  (4): [PMID:26689352] [10.1021/acs.jmedchem.5b01117]

Source