4-[({3-[2-Chloro-6-(trifluoromethyl)phenyl]-5-(naphthalen-1-yl)-1,2-oxazol-4-yl}methyl)amino]benzoic Acid

ID: ALA4514441

PubChem CID: 154649071

Max Phase: Preclinical

Molecular Formula: C28H18ClF3N2O3

Molecular Weight: 522.91

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(O)c1ccc(NCc2c(-c3c(Cl)cccc3C(F)(F)F)noc2-c2cccc3ccccc23)cc1

Standard InChI:  InChI=1S/C28H18ClF3N2O3/c29-23-10-4-9-22(28(30,31)32)24(23)25-21(15-33-18-13-11-17(12-14-18)27(35)36)26(37-34-25)20-8-3-6-16-5-1-2-7-19(16)20/h1-14,33H,15H2,(H,35,36)

Standard InChI Key:  DMVADCNPPAGEPV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
   17.5184  -24.8843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1878  -24.4083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9426  -23.6204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1131  -23.6107    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.8580  -24.3928    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.9664  -24.6691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5836  -24.1246    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.3622  -24.3895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5213  -25.1955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2991  -25.4564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9172  -24.9117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7524  -24.1028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9748  -23.8457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6961  -25.1755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8586  -25.9805    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.3126  -24.6303    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.5093  -25.7024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7945  -26.1014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7850  -26.9188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4901  -27.3346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2062  -26.9311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2121  -26.1150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4296  -22.9652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2422  -23.0619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7303  -22.4074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4071  -21.6560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1064  -22.2183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5889  -21.5662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2652  -20.8245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4594  -20.7336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9783  -21.3905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3046  -22.1296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0922  -25.6835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1029  -24.8664    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   15.3792  -26.0828    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   15.3822  -25.2710    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   18.9228  -25.7115    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  5  1  2  0
  2  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
 11 14  1  0
 14 15  2  0
 14 16  1  0
  1 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 28  1  0
 27 23  1  0
  3 23  1  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 27  2  0
 18 33  1  0
 33 34  1  0
 33 35  1  0
 33 36  1  0
 22 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4514441

    ---

Associated Targets(Human)

RORC Tchem Nuclear receptor ROR-gamma (8495 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PPARG Tclin Peroxisome proliferator-activated receptor gamma (15191 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 522.91Molecular Weight (Monoisotopic): 522.0958AlogP: 8.14#Rotatable Bonds: 6
Polar Surface Area: 75.36Molecular Species: ACIDHBA: 4HBD: 2
#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 4.73CX Basic pKa: 2.21CX LogP: 7.26CX LogD: 4.64
Aromatic Rings: 5Heavy Atoms: 37QED Weighted: 0.24Np Likeness Score: -0.97

References

1. Meijer FA, Doveston RG, de Vries RMJM, Vos GM, Vos AAA, Leysen S, Scheepstra M, Ottmann C, Milroy LG, Brunsveld L..  (2020)  Ligand-Based Design of Allosteric Retinoic Acid Receptor-Related Orphan Receptor γt (RORγt) Inverse Agonists.,  63  (1): [PMID:31821760] [10.1021/acs.jmedchem.9b01372]

Source