7-Ethyl-4-(2-methoxypyridin-4-yl)-7H-imidazo[4,5-c]pyridazine

ID: ALA4514448

PubChem CID: 155539210

Max Phase: Preclinical

Molecular Formula: C13H13N5O

Molecular Weight: 255.28

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCn1cnc2c(-c3ccnc(OC)c3)cnnc21

Standard InChI:  InChI=1S/C13H13N5O/c1-3-18-8-15-12-10(7-16-17-13(12)18)9-4-5-14-11(6-9)19-2/h4-8H,3H2,1-2H3

Standard InChI Key:  ZZZUWNYLFYIHHT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 19 21  0  0  0  0  0  0  0  0999 V2000
   12.9333  -24.9862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9322  -25.8057    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.6402  -26.2147    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.6384  -24.5773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3470  -24.9826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3519  -25.8058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1363  -26.0556    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.6163  -25.3868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1284  -24.7237    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.6332  -23.7630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3413  -23.3529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3392  -22.5365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6297  -22.1292    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.9209  -22.5443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9265  -23.3593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3933  -26.8313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8500  -27.4418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2106  -22.1403    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.2052  -21.3231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  4 10  1  0
  7 16  1  0
 16 17  1  0
 14 18  1  0
 18 19  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4514448

    ---

Associated Targets(Human)

GABRA1 Tclin GABA-A receptor; alpha-1/beta-3/gamma-2 (1565 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 255.28Molecular Weight (Monoisotopic): 255.1120AlogP: 1.92#Rotatable Bonds: 3
Polar Surface Area: 65.72Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 2.59CX LogP: 0.88CX LogD: 0.88
Aromatic Rings: 3Heavy Atoms: 19QED Weighted: 0.71Np Likeness Score: -1.46

References

1. Owen RM, Blakemore D, Cao L, Flanagan N, Fish R, Gibson KR, Gurrell R, Huh CW, Kammonen J, Mortimer-Cassen E, Nickolls SA, Omoto K, Owen D, Pike A, Pryde DC, Reynolds DS, Roeloffs R, Rose C, Stead C, Takeuchi M, Warmus JS, Watson C..  (2019)  Design and Identification of a Novel, Functionally Subtype Selective GABAA Positive Allosteric Modulator (PF-06372865).,  62  (12): [PMID:30964988] [10.1021/acs.jmedchem.9b00322]

Source