The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-[3-(6-Phenyl-4-{[(1R)-1-phenylethyl]amino}furo[2,3-d]-pyrimidin-5-yl)phenyl]prop-2-enamide ID: ALA4514452
PubChem CID: 59322732
Max Phase: Preclinical
Molecular Formula: C29H24N4O2
Molecular Weight: 460.54
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)Nc1cccc(-c2c(-c3ccccc3)oc3ncnc(N[C@H](C)c4ccccc4)c23)c1
Standard InChI: InChI=1S/C29H24N4O2/c1-3-24(34)33-23-16-10-15-22(17-23)25-26-28(32-19(2)20-11-6-4-7-12-20)30-18-31-29(26)35-27(25)21-13-8-5-9-14-21/h3-19H,1H2,2H3,(H,33,34)(H,30,31,32)/t19-/m1/s1
Standard InChI Key: GRLBXHULTTZEJM-LJQANCHMSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
6.8039 -16.6265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5077 -16.2192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2119 -16.6259 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.2119 -17.4412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5103 -17.8478 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8039 -17.4465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0249 -17.6981 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5407 -17.0364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0250 -16.3748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8117 -15.5828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0197 -15.3692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8085 -14.5803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3875 -14.0012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1745 -14.2108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3941 -15.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0205 -14.3671 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8073 -13.5792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0153 -13.3660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4365 -13.9448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3862 -13.0004 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7252 -17.0364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3150 -17.7440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4988 -17.7429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0888 -17.0349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4938 -16.3269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3128 -16.3243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5077 -15.3995 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.2196 -14.9897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2196 -14.1700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9273 -15.3995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6352 -14.9900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3435 -15.3990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3435 -16.2190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6378 -16.6279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9273 -16.2201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
1 9 1 0
10 9 1 0
11 10 2 0
12 11 1 0
13 12 2 0
14 13 1 0
15 14 2 0
10 15 1 0
12 16 1 0
16 17 1 0
17 18 1 0
18 19 2 0
17 20 2 0
21 8 1 0
22 21 2 0
23 22 1 0
24 23 2 0
25 24 1 0
26 25 2 0
21 26 1 0
2 27 1 0
27 28 1 0
28 29 1 0
28 30 1 6
31 30 2 0
32 31 1 0
33 32 2 0
34 33 1 0
35 34 2 0
30 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 460.54Molecular Weight (Monoisotopic): 460.1899AlogP: 6.85#Rotatable Bonds: 7Polar Surface Area: 80.05Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 3.03CX LogP: 5.99CX LogD: 5.99Aromatic Rings: 5Heavy Atoms: 35QED Weighted: 0.26Np Likeness Score: -0.78
References 1. Lin SY, Chang Hsu Y, Peng YH, Ke YY, Lin WH, Sun HY, Shiao HY, Kuo FM, Chen PY, Lien TW, Chen CH, Chu CY, Wang SY, Yeh KC, Chen CP, Hsu TA, Wu SY, Yeh TK, Chen CT, Hsieh HP.. (2019) Discovery of a Furanopyrimidine-Based Epidermal Growth Factor Receptor Inhibitor (DBPR112) as a Clinical Candidate for the Treatment of Non-Small Cell Lung Cancer., 62 (22): [PMID:31560541 ] [10.1021/acs.jmedchem.9b00722 ]