(S)-1-(4-(1H-pyrazol-1-yl)benzyl)-6-fluoro-4-oxo-7-((pyrrolidin-3-ylmethyl)amino)-1,4-dihydroquinoline-3-carboxylic acid

ID: ALA4514473

PubChem CID: 146433600

Max Phase: Preclinical

Molecular Formula: C25H24FN5O3

Molecular Weight: 461.50

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(O)c1cn(Cc2ccc(-n3cccn3)cc2)c2cc(NC[C@H]3CCNC3)c(F)cc2c1=O

Standard InChI:  InChI=1S/C25H24FN5O3/c26-21-10-19-23(11-22(21)28-13-17-6-8-27-12-17)30(15-20(24(19)32)25(33)34)14-16-2-4-18(5-3-16)31-9-1-7-29-31/h1-5,7,9-11,15,17,27-28H,6,8,12-14H2,(H,33,34)/t17-/m0/s1

Standard InChI Key:  GSKYNQUKABOFSS-KRWDZBQOSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
   28.3815   -1.9109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3804   -2.7304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0884   -3.1394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0866   -1.5020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7953   -1.9073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7941   -2.7279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5003   -3.1370    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.2122   -2.7299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2133   -1.9093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5026   -1.4957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5026   -0.6785    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.9220   -1.5024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6288   -1.9127    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.9240   -0.6852    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.4980   -3.9542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2046   -4.3647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6724   -3.1384    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.6737   -1.5024    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   31.2009   -5.1807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9067   -5.5912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6165   -5.1846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6162   -4.3631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9098   -3.9563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3210   -5.5940    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.4052   -6.4068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2043   -6.5779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6140   -5.8708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0680   -5.2628    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.9650   -2.7293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2569   -3.1373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5159   -2.8025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9686   -3.4094    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.3767   -4.1174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1761   -3.9480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
  9 12  1  0
 12 13  1  0
 12 14  2  0
  7 15  1  0
 15 16  1  0
  2 17  1  0
  1 18  1  0
 16 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 16  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 24  1  0
 21 24  1  0
 17 29  1  0
 30 29  1  1
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4514473

    ---

Associated Targets(Human)

TOP1 Tclin DNA topoisomerase I (7553 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 461.50Molecular Weight (Monoisotopic): 461.1863AlogP: 3.09#Rotatable Bonds: 7
Polar Surface Area: 101.18Molecular Species: ZWITTERIONHBA: 7HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 5.70CX Basic pKa: 11.01CX LogP: 0.03CX LogD: 0.02
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.39Np Likeness Score: -1.61

References

1. Delgado JL, Lentz SRC, Kulkarni CA, Chheda PR, Held HA, Hiasa H, Kerns RJ..  (2019)  Probing structural requirements for human topoisomerase I inhibition by a novel N1-Biphenyl fluoroquinolone.,  172  [PMID:30959322] [10.1016/j.ejmech.2019.03.040]

Source