The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-1-(4-(1H-pyrazol-1-yl)benzyl)-6-fluoro-4-oxo-7-((pyrrolidin-3-ylmethyl)amino)-1,4-dihydroquinoline-3-carboxylic acid ID: ALA4514473
PubChem CID: 146433600
Max Phase: Preclinical
Molecular Formula: C25H24FN5O3
Molecular Weight: 461.50
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)c1cn(Cc2ccc(-n3cccn3)cc2)c2cc(NC[C@H]3CCNC3)c(F)cc2c1=O
Standard InChI: InChI=1S/C25H24FN5O3/c26-21-10-19-23(11-22(21)28-13-17-6-8-27-12-17)30(15-20(24(19)32)25(33)34)14-16-2-4-18(5-3-16)31-9-1-7-29-31/h1-5,7,9-11,15,17,27-28H,6,8,12-14H2,(H,33,34)/t17-/m0/s1
Standard InChI Key: GSKYNQUKABOFSS-KRWDZBQOSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
28.3815 -1.9109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3804 -2.7304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0884 -3.1394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0866 -1.5020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7953 -1.9073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7941 -2.7279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5003 -3.1370 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.2122 -2.7299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2133 -1.9093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5026 -1.4957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5026 -0.6785 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.9220 -1.5024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6288 -1.9127 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.9240 -0.6852 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.4980 -3.9542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2046 -4.3647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6724 -3.1384 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.6737 -1.5024 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
31.2009 -5.1807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9067 -5.5912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6165 -5.1846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6162 -4.3631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9098 -3.9563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3210 -5.5940 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.4052 -6.4068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2043 -6.5779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6140 -5.8708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0680 -5.2628 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.9650 -2.7293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2569 -3.1373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5159 -2.8025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9686 -3.4094 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.3767 -4.1174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1761 -3.9480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
9 12 1 0
12 13 1 0
12 14 2 0
7 15 1 0
15 16 1 0
2 17 1 0
1 18 1 0
16 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 16 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 24 1 0
21 24 1 0
17 29 1 0
30 29 1 1
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 461.50Molecular Weight (Monoisotopic): 461.1863AlogP: 3.09#Rotatable Bonds: 7Polar Surface Area: 101.18Molecular Species: ZWITTERIONHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 5.70CX Basic pKa: 11.01CX LogP: 0.03CX LogD: 0.02Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.39Np Likeness Score: -1.61
References 1. Delgado JL, Lentz SRC, Kulkarni CA, Chheda PR, Held HA, Hiasa H, Kerns RJ.. (2019) Probing structural requirements for human topoisomerase I inhibition by a novel N1-Biphenyl fluoroquinolone., 172 [PMID:30959322 ] [10.1016/j.ejmech.2019.03.040 ]