The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-(5-(benzo[d][1,3]dioxol-5-yl)benzo[d]thiazol-2-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl)-3-(2-methoxyethylamino)propanamide ID: ALA4514502
PubChem CID: 155539257
Max Phase: Preclinical
Molecular Formula: C27H28N4O4S2
Molecular Weight: 536.68
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COCCNCCC(=O)Nc1sc2c(c1-c1nc3cc(-c4ccc5c(c4)OCO5)ccc3s1)CCNC2
Standard InChI: InChI=1S/C27H28N4O4S2/c1-33-11-10-28-9-7-24(32)31-27-25(18-6-8-29-14-23(18)37-27)26-30-19-12-16(3-5-22(19)36-26)17-2-4-20-21(13-17)35-15-34-20/h2-5,12-13,28-29H,6-11,14-15H2,1H3,(H,31,32)
Standard InChI Key: BGMYLAZNTFBMHA-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 42 0 0 0 0 0 0 0 0999 V2000
11.5501 -15.0431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9525 -14.0373 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.7827 -14.0520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1069 -15.0070 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.9898 -14.6595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9841 -15.2570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9636 -14.6848 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9490 -13.5150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9547 -12.9174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9752 -13.4896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0832 -13.1142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4308 -11.9971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5388 -11.6217 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.5241 -10.4518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3837 -9.6581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1262 -8.5169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0090 -8.1694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1495 -8.9630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4071 -10.1043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7313 -11.0593 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
11.9537 -7.6894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6511 -6.5589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4769 -5.7346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6076 -6.0376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9112 -7.1618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0889 -7.9936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2451 -5.0559 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.5086 -4.1462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4157 -4.5657 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.9779 -16.0635 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.7199 -15.0284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3175 -16.0342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4875 -16.0196 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.0850 -17.0253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2549 -17.0107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8525 -18.0165 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.0223 -18.0018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
5 4 1 0
6 5 1 0
6 7 1 0
8 7 1 0
9 8 1 0
10 9 1 0
5 10 2 0
10 11 1 0
11 3 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
16 15 1 0
17 16 2 0
18 17 1 0
19 18 2 0
14 19 1 0
20 19 1 0
20 12 1 0
16 21 1 0
22 21 2 0
23 22 1 0
24 23 2 0
25 24 1 0
26 25 2 0
21 26 1 0
24 27 1 0
28 27 1 0
29 28 1 0
23 29 1 0
1 30 2 0
1 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 536.68Molecular Weight (Monoisotopic): 536.1552AlogP: 4.63#Rotatable Bonds: 9Polar Surface Area: 93.74Molecular Species: BASEHBA: 9HBD: 3#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.51CX Basic pKa: 9.13CX LogP: 3.85CX LogD: 1.30Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.27Np Likeness Score: -1.38
References 1. (2018) Compounds for the modulation of myc activity,