The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(1-(2-((3-Cyanophenyl)amino)-2-oxoethyl)-2,3-dioxoindolin-5-yl)butyramide ID: ALA4514521
PubChem CID: 155539382
Max Phase: Preclinical
Molecular Formula: C21H18N4O4
Molecular Weight: 390.40
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCCC(=O)Nc1ccc2c(c1)C(=O)C(=O)N2CC(=O)Nc1cccc(C#N)c1
Standard InChI: InChI=1S/C21H18N4O4/c1-2-4-18(26)23-15-7-8-17-16(10-15)20(28)21(29)25(17)12-19(27)24-14-6-3-5-13(9-14)11-22/h3,5-10H,2,4,12H2,1H3,(H,23,26)(H,24,27)
Standard InChI Key: HIRFQDUHVIUBDA-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 31 0 0 0 0 0 0 0 0999 V2000
8.0756 -17.6067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0744 -18.4263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7825 -18.8352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7807 -17.1979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4893 -17.6031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4941 -18.4217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2741 -18.6702 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.7515 -18.0051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2664 -17.3457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5687 -18.0002 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.5143 -16.5670 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.2685 -19.4846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9734 -19.8981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3678 -17.1983 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6601 -17.6071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9523 -17.1986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6603 -18.4242 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2447 -17.6074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9678 -20.7153 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.6839 -19.4943 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.3888 -19.9078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3816 -20.7239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0857 -21.1372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7971 -20.7334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8001 -19.9120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0955 -19.5023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5070 -19.5064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2161 -19.1001 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.5369 -17.1990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 5 1 0
8 10 2 0
9 11 2 0
7 12 1 0
12 13 1 0
1 14 1 0
14 15 1 0
15 16 1 0
15 17 2 0
16 18 1 0
13 19 2 0
13 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
27 28 3 0
25 27 1 0
18 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 390.40Molecular Weight (Monoisotopic): 390.1328AlogP: 2.46#Rotatable Bonds: 6Polar Surface Area: 119.37Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.26CX Basic pKa: ┄CX LogP: 1.97CX LogD: 1.97Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.73Np Likeness Score: -1.69
References 1. Yu S, Liu Y, Zhang Z, Zhang J, Zhao G.. (2019) Design, synthesis and biological evaluation of novel 2,3-indolinedione derivatives against mantle cell lymphoma., 27 (15): [PMID:31229421 ] [10.1016/j.bmc.2019.06.009 ]