The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N1-(2-(5-chloro-2,4-dimethoxyphenyl)-7-morpholinoimidazo[1,2-a]pyridine-6-yl)ethane-1,2-diamine ID: ALA4514527
PubChem CID: 140914431
Max Phase: Preclinical
Molecular Formula: C21H26ClN5O3
Molecular Weight: 431.92
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(OC)c(-c2cn3cc(NCCN)c(N4CCOCC4)cc3n2)cc1Cl
Standard InChI: InChI=1S/C21H26ClN5O3/c1-28-19-11-20(29-2)15(22)9-14(19)16-12-27-13-17(24-4-3-23)18(10-21(27)25-16)26-5-7-30-8-6-26/h9-13,24H,3-8,23H2,1-2H3
Standard InChI Key: MUKGJPMFENLBMW-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
16.1773 -8.8240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1762 -9.6435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8842 -10.0525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8824 -8.4151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3749 -8.5642 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.5911 -8.8204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5936 -9.6456 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.3799 -9.8969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8607 -9.2261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6767 -9.2207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0887 -9.9277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9051 -9.9234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3105 -9.2128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8935 -8.5051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0784 -8.5129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1261 -9.2120 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.7039 -9.7898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2965 -7.7922 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
19.6745 -10.6317 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.8573 -10.6317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4695 -8.4155 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.4720 -7.5930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7683 -7.1847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0583 -7.5900 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.0565 -8.4081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7647 -8.8210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4681 -10.0515 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.7608 -9.6424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0527 -10.0504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3453 -9.6413 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 7 1 0
6 4 1 0
4 1 2 0
6 7 1 0
5 6 2 0
7 8 1 0
8 9 2 0
9 5 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
9 10 1 0
13 16 1 0
16 17 1 0
14 18 1 0
11 19 1 0
19 20 1 0
1 21 1 0
21 22 1 0
21 26 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
2 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 431.92Molecular Weight (Monoisotopic): 431.1724AlogP: 2.88#Rotatable Bonds: 7Polar Surface Area: 86.28Molecular Species: BASEHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.62CX LogP: 1.65CX LogD: -0.54Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.59Np Likeness Score: -1.43
References 1. (2018) Bicyclic compound and use thereof for inhibiting suv39h2,