The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
NA ID: ALA4514531
PubChem CID: 134824319
Max Phase: Preclinical
Molecular Formula: C19H16N4O5S
Molecular Weight: 412.43
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(=O)oc2cc(OCc3cn(-c4ccc(S(N)(=O)=O)cc4)nn3)ccc12
Standard InChI: InChI=1S/C19H16N4O5S/c1-12-8-19(24)28-18-9-15(4-7-17(12)18)27-11-13-10-23(22-21-13)14-2-5-16(6-3-14)29(20,25)26/h2-10H,11H2,1H3,(H2,20,25,26)
Standard InChI Key: FZDBFKSUQGXABT-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 32 0 0 0 0 0 0 0 0999 V2000
8.5386 -2.5332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2530 -2.1210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9647 -2.5327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9647 -3.3578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2548 -3.7695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5386 -3.3615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6792 -3.7703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3937 -3.3578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3937 -2.5328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6792 -2.1203 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.1082 -2.1203 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.6792 -4.5953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8241 -2.1207 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1097 -2.5332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3952 -2.1207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6419 -2.4560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0901 -1.8433 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5023 -1.1291 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3090 -1.3006 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2651 -1.8433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8523 -2.5576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0298 -2.5569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6172 -1.8422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0263 -1.1305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8508 -1.1257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7922 -1.8422 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.3797 -2.5567 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7922 -1.0156 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0778 -1.4281 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
4 7 1 0
7 8 2 0
8 9 1 0
9 10 1 0
3 10 1 0
9 11 2 0
7 12 1 0
1 13 1 0
13 14 1 0
14 15 1 0
16 15 2 0
16 17 1 0
17 18 1 0
18 19 2 0
19 15 1 0
20 17 1 0
21 20 2 0
22 21 1 0
23 22 2 0
24 23 1 0
25 24 2 0
20 25 1 0
23 26 1 0
26 27 1 0
26 28 2 0
26 29 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 412.43Molecular Weight (Monoisotopic): 412.0841AlogP: 1.91#Rotatable Bonds: 5Polar Surface Area: 130.31Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.56CX Basic pKa: ┄CX LogP: 2.04CX LogD: 2.04Aromatic Rings: 4Heavy Atoms: 29QED Weighted: 0.50Np Likeness Score: -1.62
References 1. Xu Z, Zhao SJ, Liu Y.. (2019) 1,2,3-Triazole-containing hybrids as potential anticancer agents: Current developments, action mechanisms and structure-activity relationships., 183 [PMID:31546197 ] [10.1016/j.ejmech.2019.111700 ]