The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
C0225445 ID: ALA4514554
PubChem CID: 45499923
Max Phase: Preclinical
Molecular Formula: C24H21ClN6O2
Molecular Weight: 460.93
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(NC(=O)Cn2nc3c4cc(-c5ccc(C)c(C)c5)nn4ccn3c2=O)c(Cl)c1
Standard InChI: InChI=1S/C24H21ClN6O2/c1-14-4-7-19(18(25)10-14)26-22(32)13-31-24(33)29-8-9-30-21(23(29)28-31)12-20(27-30)17-6-5-15(2)16(3)11-17/h4-12H,13H2,1-3H3,(H,26,32)
Standard InChI Key: QBPLUBFXIOSMPQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
-1.5669 0.7062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4717 1.8317 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.3393 -0.5738 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.6110 -1.8759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.8538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6621 -0.5517 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1186 -0.2648 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.2952 1.1917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6099 1.9154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7452 3.4046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1072 4.0332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3325 3.1679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1959 1.6742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1761 0.9820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8339 1.0456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4221 3.6708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9490 1.8317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8180 -0.2428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9504 1.2359 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.2371 2.0020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2184 3.5027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1717 4.0895 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.5083 4.2701 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.4896 5.7708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1799 6.5020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1582 8.0019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4462 8.7706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7560 8.0394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7777 6.5396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.8255 5.9547 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-6.4289 9.9704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7202 -1.0340 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 3
1 3 1 0
3 4 1 0
4 5 2 3
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 1 0
13 15 2 0
15 9 1 0
12 16 1 0
8 17 1 0
6 18 1 0
18 1 1 0
18 17 2 0
3 19 1 0
19 20 1 0
20 2 1 0
20 21 1 0
21 22 1 0
22 23 2 0
22 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
30 31 1 0
28 32 1 0
19 33 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 460.93Molecular Weight (Monoisotopic): 460.1415AlogP: 4.03#Rotatable Bonds: 4Polar Surface Area: 85.70Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.56CX Basic pKa: ┄CX LogP: 5.37CX LogD: 5.37Aromatic Rings: 5Heavy Atoms: 33QED Weighted: 0.44Np Likeness Score: -2.31
References 1. Johannes Zuegg, Alysha Elliott, Maite Amado, Emma Cowie, Ali Hinton, Geraldine Kaeslin, Angela Kavanagh, Anne Kunert, Gabriell Lowe, Soumya Ramu, Janet Reid, Robin Trauer, Mathilde Desselle, Ruth Neale, Karl Hansford, Mark Blascovich, Matthew Cooper. CO-ADD screening of Karazin Kharkiv National University (Ukraine) compounds, [10.6019/CHEMBL4513146 ]