4-(4-(Cyclohexyl(isobutyl)amino)-3-(3-(m-tolyl)ureido)phenyl)-2,5-dimethylfuran-3-carboxylic acid

ID: ALA4514602

PubChem CID: 155539290

Max Phase: Preclinical

Molecular Formula: C31H39N3O4

Molecular Weight: 517.67

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cccc(NC(=O)Nc2cc(-c3c(C)oc(C)c3C(=O)O)ccc2N(CC(C)C)C2CCCCC2)c1

Standard InChI:  InChI=1S/C31H39N3O4/c1-19(2)18-34(25-12-7-6-8-13-25)27-15-14-23(28-21(4)38-22(5)29(28)30(35)36)17-26(27)33-31(37)32-24-11-9-10-20(3)16-24/h9-11,14-17,19,25H,6-8,12-13,18H2,1-5H3,(H,35,36)(H2,32,33,37)

Standard InChI Key:  FAKFGDFZAAHHJV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 38 41  0  0  0  0  0  0  0  0999 V2000
   15.8389  -18.8738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8377  -19.6933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5458  -20.1023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2554  -19.6928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2526  -18.8702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5440  -18.4649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9638  -20.1003    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.9588  -18.4589    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.9557  -17.6417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6619  -17.2305    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.2465  -17.2358    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.1311  -18.4661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0454  -17.6534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2460  -17.4837    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.8376  -18.1916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3846  -18.7986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0249  -18.2773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6526  -17.1065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2149  -19.5980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4378  -19.8508    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.8224  -20.1447    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.3711  -17.6364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3694  -18.4539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0778  -18.8598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7850  -18.4485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7792  -17.6270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0703  -17.2249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9651  -20.9175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6709  -19.6906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2511  -21.3247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2505  -22.1383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9570  -22.5496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6659  -22.1411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6682  -21.3213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3792  -20.0981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3805  -20.9153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0863  -19.6884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4839  -17.2133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  5  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  2  0
 12 13  2  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 16 12  1  0
  1 12  1  0
 15 17  1  0
 13 18  1  0
 16 19  1  0
 19 20  1  0
 19 21  2  0
 10 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
  7 28  1  0
  7 29  1  0
 28 30  1  0
 28 34  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 29 35  1  0
 35 36  1  0
 35 37  1  0
 26 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4514602

    ---

Associated Targets(Human)

IDO1 Tchem Indoleamine 2,3-dioxygenase (6650 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 517.67Molecular Weight (Monoisotopic): 517.2941AlogP: 8.01#Rotatable Bonds: 8
Polar Surface Area: 94.81Molecular Species: ACIDHBA: 4HBD: 3
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 3.86CX Basic pKa: 4.73CX LogP: 6.71CX LogD: 4.52
Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.28Np Likeness Score: -1.14

References

1. Yang X, Cai S, Liu X, Chen P, Zhou J, Zhang H..  (2019)  Design, synthesis and biological evaluation of 2,5-dimethylfuran-3-carboxylic acid derivatives as potential IDO1 inhibitors.,  27  (8): [PMID:30858027] [10.1016/j.bmc.2019.03.005]

Source