The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(4-(Cyclohexyl(isobutyl)amino)-3-(3-(m-tolyl)ureido)phenyl)-2,5-dimethylfuran-3-carboxylic acid ID: ALA4514602
PubChem CID: 155539290
Max Phase: Preclinical
Molecular Formula: C31H39N3O4
Molecular Weight: 517.67
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cccc(NC(=O)Nc2cc(-c3c(C)oc(C)c3C(=O)O)ccc2N(CC(C)C)C2CCCCC2)c1
Standard InChI: InChI=1S/C31H39N3O4/c1-19(2)18-34(25-12-7-6-8-13-25)27-15-14-23(28-21(4)38-22(5)29(28)30(35)36)17-26(27)33-31(37)32-24-11-9-10-20(3)16-24/h9-11,14-17,19,25H,6-8,12-13,18H2,1-5H3,(H,35,36)(H2,32,33,37)
Standard InChI Key: FAKFGDFZAAHHJV-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 41 0 0 0 0 0 0 0 0999 V2000
15.8389 -18.8738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8377 -19.6933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5458 -20.1023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2554 -19.6928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2526 -18.8702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5440 -18.4649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9638 -20.1003 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.9588 -18.4589 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.9557 -17.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6619 -17.2305 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.2465 -17.2358 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.1311 -18.4661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0454 -17.6534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2460 -17.4837 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.8376 -18.1916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3846 -18.7986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0249 -18.2773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6526 -17.1065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2149 -19.5980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4378 -19.8508 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.8224 -20.1447 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.3711 -17.6364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3694 -18.4539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0778 -18.8598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7850 -18.4485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7792 -17.6270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0703 -17.2249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9651 -20.9175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6709 -19.6906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2511 -21.3247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2505 -22.1383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9570 -22.5496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6659 -22.1411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6682 -21.3213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3792 -20.0981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3805 -20.9153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0863 -19.6884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4839 -17.2133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
5 8 1 0
8 9 1 0
9 10 1 0
9 11 2 0
12 13 2 0
13 14 1 0
14 15 1 0
15 16 2 0
16 12 1 0
1 12 1 0
15 17 1 0
13 18 1 0
16 19 1 0
19 20 1 0
19 21 2 0
10 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
7 28 1 0
7 29 1 0
28 30 1 0
28 34 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
29 35 1 0
35 36 1 0
35 37 1 0
26 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 517.67Molecular Weight (Monoisotopic): 517.2941AlogP: 8.01#Rotatable Bonds: 8Polar Surface Area: 94.81Molecular Species: ACIDHBA: 4HBD: 3#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.86CX Basic pKa: 4.73CX LogP: 6.71CX LogD: 4.52Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.28Np Likeness Score: -1.14
References 1. Yang X, Cai S, Liu X, Chen P, Zhou J, Zhang H.. (2019) Design, synthesis and biological evaluation of 2,5-dimethylfuran-3-carboxylic acid derivatives as potential IDO1 inhibitors., 27 (8): [PMID:30858027 ] [10.1016/j.bmc.2019.03.005 ]