The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Ethyl 2-((3-(5-allyl-2-methoxyphenyl)isoxazol-5-yl)methoxy)acetate ID: ALA4514631
PubChem CID: 155539434
Max Phase: Preclinical
Molecular Formula: C18H21NO5
Molecular Weight: 331.37
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C=CCc1ccc(OC)c(-c2cc(COCC(=O)OCC)on2)c1
Standard InChI: InChI=1S/C18H21NO5/c1-4-6-13-7-8-17(21-3)15(9-13)16-10-14(24-19-16)11-22-12-18(20)23-5-2/h4,7-10H,1,5-6,11-12H2,2-3H3
Standard InChI Key: HTFFSXKLBSBQDX-UHFFFAOYSA-N
Molfile:
RDKit 2D
24 25 0 0 0 0 0 0 0 0999 V2000
4.6225 -20.8425 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9555 -21.3246 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2097 -22.1055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0311 -22.1055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2854 -21.3246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0870 -22.5222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0858 -23.3418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7939 -23.7507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5035 -23.3413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5007 -22.5186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7921 -22.1134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7896 -21.2962 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9886 -20.9085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0807 -20.8897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7007 -21.3095 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7937 -24.5679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0859 -24.9764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0857 -25.7936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4039 -20.8934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1160 -21.2944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8193 -20.8782 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1247 -22.1115 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5313 -21.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2346 -20.8630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
1 2 1 0
3 4 1 0
4 5 2 0
5 1 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
11 12 1 0
10 3 1 0
5 13 1 0
12 14 1 0
13 15 1 0
8 16 1 0
16 17 1 0
17 18 2 0
15 19 1 0
19 20 1 0
20 21 1 0
20 22 2 0
21 23 1 0
23 24 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 331.37Molecular Weight (Monoisotopic): 331.1420AlogP: 3.16#Rotatable Bonds: 9Polar Surface Area: 70.79Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.09CX LogD: 3.09Aromatic Rings: 2Heavy Atoms: 24QED Weighted: 0.52Np Likeness Score: -0.72
References 1. Yuan Y, Subedi L, Lim D, Jung JK, Kim SY, Seo SY.. (2019) Synthesis and anti-neuroinflammatory activity of N-heterocyclic analogs based on natural biphenyl-neolignan honokiol., 29 (2): [PMID:30472026 ] [10.1016/j.bmcl.2018.11.014 ]