The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Ethyl 5-((6-(2,3-dioxoindolin-1-yl)hexyl)oxy)-2-(4-methoxyphenyl)benzofuran-3-carboxylate ID: ALA4514642
PubChem CID: 155539561
Max Phase: Preclinical
Molecular Formula: C32H31NO7
Molecular Weight: 541.60
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)c1c(-c2ccc(OC)cc2)oc2ccc(OCCCCCCN3C(=O)C(=O)c4ccccc43)cc12
Standard InChI: InChI=1S/C32H31NO7/c1-3-38-32(36)28-25-20-23(16-17-27(25)40-30(28)21-12-14-22(37-2)15-13-21)39-19-9-5-4-8-18-33-26-11-7-6-10-24(26)29(34)31(33)35/h6-7,10-17,20H,3-5,8-9,18-19H2,1-2H3
Standard InChI Key: FFZKROPVSAXFAT-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
5.1485 -1.5832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4364 -1.9888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4327 -2.8064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8534 -1.9925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8531 -2.8088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1447 -3.2191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3160 -4.0197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1304 -4.1041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4622 -3.3558 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5400 -4.8112 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7701 -4.6277 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1713 -2.9435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8802 -3.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5867 -2.9393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2957 -3.3458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0021 -2.9351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7111 -3.3416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4176 -2.9309 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.1265 -3.3374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1255 -4.1531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8336 -4.5595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8273 -2.9246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5360 -3.3273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5419 -4.1446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3210 -4.3915 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.7966 -3.7268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3114 -3.0692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5582 -2.2902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3563 -2.1144 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.0070 -1.6869 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.6032 -1.3354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4012 -1.1597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6110 -3.7199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0242 -4.4262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8406 -4.4206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2448 -3.7094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8267 -3.0023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0116 -3.0115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0620 -3.7023 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.4767 -4.4064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 5 1 0
8 10 2 0
7 11 2 0
9 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 24 2 0
23 22 2 0
22 19 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 2 0
27 23 1 0
27 28 1 0
28 29 1 0
28 30 2 0
29 31 1 0
31 32 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 33 1 0
26 33 1 0
36 39 1 0
39 40 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 541.60Molecular Weight (Monoisotopic): 541.2101AlogP: 6.45#Rotatable Bonds: 12Polar Surface Area: 95.28Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.86CX LogD: 5.86Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.12Np Likeness Score: -0.44
References 1. Gao F, Chen Z, Ma L, Qiu L, Lin J, Lu G.. (2019) Benzofuran-isatin hybrids tethered via different length alkyl linkers and their in vitro anti-mycobacterial activities., 27 (12): [PMID:30992202 ] [10.1016/j.bmc.2019.04.017 ] 2. Gao F, Wang T, Gao M, Zhang X, Liu Z, Zhao S, Lv Z, Xiao J.. (2019) Benzofuran-isatin-imine hybrids tethered via different length alkyl linkers: Design, synthesis and in vitro evaluation of anti-tubercular and anti-bacterial activities as well as cytotoxicity., 165 [PMID:30690301 ] [10.1016/j.ejmech.2019.01.042 ]