The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-chloro-6-((4-(2,4-difluorophenyl)-1H-1,2,3-triazol-1-yl)methyl)-2-(thiophen-2-yl)-7,8-dihydroquinoline ID: ALA4514659
PubChem CID: 155539491
Max Phase: Preclinical
Molecular Formula: C22H15ClF2N4S
Molecular Weight: 440.91
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Fc1ccc(-c2cn(CC3=C(Cl)c4ccc(-c5cccs5)nc4CC3)nn2)c(F)c1
Standard InChI: InChI=1S/C22H15ClF2N4S/c23-22-13(3-7-18-16(22)6-8-19(26-18)21-2-1-9-30-21)11-29-12-20(27-28-29)15-5-4-14(24)10-17(15)25/h1-2,4-6,8-10,12H,3,7,11H2
Standard InChI Key: IYUJNJOUFVRSBE-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 34 0 0 0 0 0 0 0 0999 V2000
5.0108 -20.9450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0097 -21.7724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7245 -22.1851 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.7226 -20.5323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4381 -20.9413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4369 -21.7698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1498 -22.1827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8685 -21.7718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8696 -20.9433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1521 -20.5259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1521 -19.7009 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
4.2977 -22.1876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5443 -21.8514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9918 -22.4641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4038 -23.1789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2108 -23.0079 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
8.5850 -20.5327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2986 -20.9469 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.3844 -21.7639 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.1909 -21.9374 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.6052 -21.2239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0546 -20.6096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4220 -21.1388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9048 -21.8090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7248 -21.7251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0628 -20.9716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5748 -20.3012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7566 -20.3884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2715 -19.7212 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.8834 -20.8862 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 12 1 0
2 12 1 0
9 17 1 0
17 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 18 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
21 23 1 0
28 29 1 0
26 30 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 440.91Molecular Weight (Monoisotopic): 440.0674AlogP: 5.94#Rotatable Bonds: 4Polar Surface Area: 43.60Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 3.21CX LogP: 5.59CX LogD: 5.59Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.39Np Likeness Score: -1.77
References 1. Marvadi SK, Krishna VS, Sinegubova EO, Volobueva AS, Esaulkova YL, Muryleva AA, Tentler DG, Sriram D, Zarubaev VV, Kantevari S.. (2019) 5-Chloro-2-thiophenyl-1,2,3-triazolylmethyldihydroquinolines as dual inhibitors of Mycobacterium tuberculosis and influenza virus: Synthesis and evaluation., 29 (18): [PMID:31375291 ] [10.1016/j.bmcl.2019.07.040 ]