The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(5-chloro-2,4-dimethoxyphenyl)-7-(4-(methylsulfonyl)piperazin-1-yl)imidazo[1,2-a]pyrimidine ID: ALA4514682
PubChem CID: 135335526
Max Phase: Preclinical
Molecular Formula: C19H22ClN5O4S
Molecular Weight: 451.94
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(OC)c(-c2cn3ccc(N4CCN(S(C)(=O)=O)CC4)nc3n2)cc1Cl
Standard InChI: InChI=1S/C19H22ClN5O4S/c1-28-16-11-17(29-2)14(20)10-13(16)15-12-24-5-4-18(22-19(24)21-15)23-6-8-25(9-7-23)30(3,26)27/h4-5,10-12H,6-9H2,1-3H3
Standard InChI Key: VIVXOSVUPRMYMR-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
37.2524 -17.4417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.6651 -18.1516 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
38.0735 -17.4392 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.4908 -19.7983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4897 -20.6178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1977 -21.0268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1959 -19.3894 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.6884 -19.5385 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.9046 -19.7947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9071 -20.6199 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.6934 -20.8712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.1742 -20.2004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.9902 -20.1950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.4022 -20.9020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.2186 -20.8977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.6240 -20.1871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.2070 -19.4794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.3919 -19.4872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.4396 -20.1863 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
47.0174 -20.7641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.6100 -18.7665 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
43.9880 -21.6060 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.1708 -21.6060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7837 -19.3855 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.7855 -18.5673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0818 -18.1590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3718 -18.5643 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.3700 -19.3824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0782 -19.7953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9563 -18.5593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
5 6 2 0
6 10 1 0
9 7 1 0
7 4 2 0
9 10 1 0
8 9 2 0
10 11 1 0
11 12 2 0
12 8 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
12 13 1 0
16 19 1 0
19 20 1 0
17 21 1 0
14 22 1 0
22 23 1 0
24 25 1 0
24 29 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
4 24 1 0
27 2 1 0
2 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 451.94Molecular Weight (Monoisotopic): 451.1081AlogP: 2.15#Rotatable Bonds: 5Polar Surface Area: 89.27Molecular Species: NEUTRALHBA: 8HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 2.34CX LogP: 1.40CX LogD: 1.40Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.59Np Likeness Score: -1.76
References 1. (2018) Bicyclic compound and use thereof for inhibiting suv39h2,